![]() |
Name |
guhypoxylonol D
|
Molecular Formula | C25H30O9 | |
IUPAC Name* |
methyl2-[2-[3-[2,4-dihydroxy-6-(2-methoxy-2-oxoethyl)-3,5-dimethylphenyl]-2-oxopropyl]-3,5-dihydroxy-4,6-dimethylphenyl]acetate
|
|
SMILES |
COC(=O)Cc1c(C)c(O)c(C)c(O)c1CC(=O)Cc1c(O)c(C)c(O)c(C)c1CC(=O)OC
|
|
InChI |
InChI=1S/C25H30O9/c1-11-16(9-20(27)33-5)18(24(31)13(3)22(11)29)7-15(26)8-19-17(10-21(28)34-6)12(2)23(30)14(4)25(19)32/h29-32H,7-10H2,1-6H3
|
|
InChIKey |
ZVNBZJVDICDWFB-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 474.51 | ALogp: | 2.5 |
HBD: | 4 | HBA: | 9 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 150.6 | Aromatic Rings: | 2 |
Heavy Atoms: | 34 | QED Weighted: | 0.422 |
Caco-2 Permeability: | -5.882 | MDCK Permeability: | 0.00001150 |
Pgp-inhibitor: | 0.738 | Pgp-substrate: | 0.997 |
Human Intestinal Absorption (HIA): | 0.191 | 20% Bioavailability (F20%): | 0.969 |
30% Bioavailability (F30%): | 0.043 |
Blood-Brain-Barrier Penetration (BBB): | 0.006 | Plasma Protein Binding (PPB): | 92.60% |
Volume Distribution (VD): | 0.596 | Fu: | 9.03% |
CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.711 |
CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.332 |
CYP2C9-inhibitor: | 0.292 | CYP2C9-substrate: | 0.918 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.188 |
CYP3A4-inhibitor: | 0.122 | CYP3A4-substrate: | 0.746 |
Clearance (CL): | 14.077 | Half-life (T1/2): | 0.975 |
hERG Blockers: | 0.082 | Human Hepatotoxicity (H-HT): | 0.69 |
Drug-inuced Liver Injury (DILI): | 0.907 | AMES Toxicity: | 0.039 |
Rat Oral Acute Toxicity: | 0.023 | Maximum Recommended Daily Dose: | 0.048 |
Skin Sensitization: | 0.799 | Carcinogencity: | 0.018 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.445 |
Respiratory Toxicity: | 0.033 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004141 | ![]() |
0.350 | D0WY9N | ![]() |
0.341 | ||
ENC000992 | ![]() |
0.338 | D0I3XG | ![]() |
0.257 | ||
ENC002078 | ![]() |
0.326 | D04WJO | ![]() |
0.230 | ||
ENC002085 | ![]() |
0.322 | D0FR9L | ![]() |
0.215 | ||
ENC003651 | ![]() |
0.321 | D09ELP | ![]() |
0.214 | ||
ENC003695 | ![]() |
0.316 | D0Q0PR | ![]() |
0.209 | ||
ENC004140 | ![]() |
0.315 | D07IPB | ![]() |
0.207 | ||
ENC005301 | ![]() |
0.313 | D0FX2Q | ![]() |
0.207 | ||
ENC004805 | ![]() |
0.312 | D0G4OD | ![]() |
0.199 | ||
ENC003680 | ![]() |
0.312 | D06XZW | ![]() |
0.199 |