![]() |
Name |
Thielavin K
|
Molecular Formula | C30H32O10 | |
IUPAC Name* |
4-[4-(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-hydroxy-3,5,6-trimethylbenzoic acid
|
|
SMILES |
CC1=CC(=C(C(=C1C(=O)OC2=C(C(=C(C(=C2C)C)C(=O)OC3=C(C(=C(C(=C3C)C)C(=O)O)O)C)OC)C)O)C)O
|
|
InChI |
InChI=1S/C30H32O10/c1-11-10-19(31)16(6)23(32)20(11)29(36)40-26-15(5)13(3)22(27(38-9)18(26)8)30(37)39-25-14(4)12(2)21(28(34)35)24(33)17(25)7/h10,31-33H,1-9H3,(H,34,35)
|
|
InChIKey |
IGYZEKLJQWCRPT-UHFFFAOYSA-N
|
|
Synonyms |
Thielavin K; 4-[4-(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-hydroxy-3,5,6-trimethylbenzoic acid
|
|
CAS | NA | |
PubChem CID | 10940623 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 552.6 | ALogp: | 7.2 |
HBD: | 4 | HBA: | 10 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 160.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 40 | QED Weighted: | 0.223 |
Caco-2 Permeability: | -5.613 | MDCK Permeability: | 0.00001380 |
Pgp-inhibitor: | 0.419 | Pgp-substrate: | 0.916 |
Human Intestinal Absorption (HIA): | 0.933 | 20% Bioavailability (F20%): | 0.341 |
30% Bioavailability (F30%): | 0.037 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 99.80% |
Volume Distribution (VD): | 0.263 | Fu: | 1.20% |
CYP1A2-inhibitor: | 0.038 | CYP1A2-substrate: | 0.944 |
CYP2C19-inhibitor: | 0.047 | CYP2C19-substrate: | 0.066 |
CYP2C9-inhibitor: | 0.581 | CYP2C9-substrate: | 0.118 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.117 |
CYP3A4-inhibitor: | 0.049 | CYP3A4-substrate: | 0.09 |
Clearance (CL): | 2.507 | Half-life (T1/2): | 0.317 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.054 |
Drug-inuced Liver Injury (DILI): | 0.821 | AMES Toxicity: | 0.024 |
Rat Oral Acute Toxicity: | 0.478 | Maximum Recommended Daily Dose: | 0.657 |
Skin Sensitization: | 0.364 | Carcinogencity: | 0.028 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.929 |
Respiratory Toxicity: | 0.132 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000992 | ![]() |
0.864 | D0WY9N | ![]() |
0.306 | ||
ENC002078 | ![]() |
0.807 | D03RTK | ![]() |
0.232 | ||
ENC003651 | ![]() |
0.633 | D0I3XG | ![]() |
0.232 | ||
ENC003680 | ![]() |
0.620 | D0FX2Q | ![]() |
0.228 | ||
ENC005301 | ![]() |
0.619 | D04WJO | ![]() |
0.225 | ||
ENC004140 | ![]() |
0.568 | D04ITO | ![]() |
0.217 | ||
ENC003695 | ![]() |
0.528 | D0V6OA | ![]() |
0.213 | ||
ENC004141 | ![]() |
0.475 | D0Q0PR | ![]() |
0.212 | ||
ENC003758 | ![]() |
0.422 | D0L5FY | ![]() |
0.209 | ||
ENC004448 | ![]() |
0.338 | D05QDC | ![]() |
0.209 |