![]() |
Name |
Talaketides D
|
Molecular Formula | C10H16O3 | |
IUPAC Name* |
4-methoxy-1,3-dimethyl-6-methylidenecyclohex-4-ene-1,2-diol
|
|
SMILES |
C=C1C=C(OC)C(C)C(O)C1(C)O
|
|
InChI |
InChI=1S/C10H16O3/c1-6-5-8(13-4)7(2)9(11)10(6,3)12/h5,7,9,11-12H,1H2,2-4H3/t7-,9+,10+/m0/s1
|
|
InChIKey |
MTTLYYGJMSXYCL-FXBDTBDDSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 184.23 | ALogp: | 0.8 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.7 | Aromatic Rings: | 1 |
Heavy Atoms: | 13 | QED Weighted: | 0.645 |
Caco-2 Permeability: | -4.613 | MDCK Permeability: | 0.00003340 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.023 |
Human Intestinal Absorption (HIA): | 0.083 | 20% Bioavailability (F20%): | 0.034 |
30% Bioavailability (F30%): | 0.006 |
Blood-Brain-Barrier Penetration (BBB): | 0.996 | Plasma Protein Binding (PPB): | 51.48% |
Volume Distribution (VD): | 1.411 | Fu: | 59.93% |
CYP1A2-inhibitor: | 0.022 | CYP1A2-substrate: | 0.615 |
CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.857 |
CYP2C9-inhibitor: | 0.008 | CYP2C9-substrate: | 0.123 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.156 |
CYP3A4-inhibitor: | 0.01 | CYP3A4-substrate: | 0.233 |
Clearance (CL): | 7.127 | Half-life (T1/2): | 0.661 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.475 |
Drug-inuced Liver Injury (DILI): | 0.361 | AMES Toxicity: | 0.058 |
Rat Oral Acute Toxicity: | 0.952 | Maximum Recommended Daily Dose: | 0.072 |
Skin Sensitization: | 0.342 | Carcinogencity: | 0.881 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.099 |
Respiratory Toxicity: | 0.95 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004965 | ![]() |
0.692 | D0L2LS | ![]() |
0.181 | ||
ENC004966 | ![]() |
0.692 | D0P0HT | ![]() |
0.180 | ||
ENC005579 | ![]() |
0.391 | D05GKD | ![]() |
0.178 | ||
ENC001525 | ![]() |
0.354 | D08PIQ | ![]() |
0.178 | ||
ENC005472 | ![]() |
0.354 | D07DVK | ![]() |
0.174 | ||
ENC004166 | ![]() |
0.333 | D0CW1P | ![]() |
0.174 | ||
ENC004165 | ![]() |
0.333 | D0FL5V | ![]() |
0.174 | ||
ENC004167 | ![]() |
0.314 | D03IKT | ![]() |
0.174 | ||
ENC004168 | ![]() |
0.314 | D0IT2G | ![]() |
0.174 | ||
ENC003147 | ![]() |
0.291 | D0F1EX | ![]() |
0.174 |