![]() |
Name |
(-)-nigrosporione A
|
Molecular Formula | C9H12O4 | |
IUPAC Name* |
(3R,3aR,6aR)-3-hydroxy-4-methoxy-6a-methyl-3,3a-dihydro-1H-cyclopenta[c]furan-6-one
|
|
SMILES |
C[C@]12CO[C@H]([C@H]1C(=CC2=O)OC)O
|
|
InChI |
InChI=1S/C9H12O4/c1-9-4-13-8(11)7(9)5(12-2)3-6(9)10/h3,7-8,11H,4H2,1-2H3/t7-,8-,9-/m1/s1
|
|
InChIKey |
PBCAFSVBCMHJCT-IWSPIJDZSA-N
|
|
Synonyms |
(-)-nigrosporione A
|
|
CAS | NA | |
PubChem CID | 146684211 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 184.19 | ALogp: | -0.5 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 13 | QED Weighted: | 0.643 |
Caco-2 Permeability: | -4.914 | MDCK Permeability: | 0.00003490 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.949 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.041 |
30% Bioavailability (F30%): | 0.008 |
Blood-Brain-Barrier Penetration (BBB): | 0.899 | Plasma Protein Binding (PPB): | 34.46% |
Volume Distribution (VD): | 1.386 | Fu: | 73.97% |
CYP1A2-inhibitor: | 0.019 | CYP1A2-substrate: | 0.624 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.848 |
CYP2C9-inhibitor: | 0.012 | CYP2C9-substrate: | 0.078 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.098 |
CYP3A4-inhibitor: | 0.023 | CYP3A4-substrate: | 0.61 |
Clearance (CL): | 3.251 | Half-life (T1/2): | 0.844 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.154 |
Drug-inuced Liver Injury (DILI): | 0.929 | AMES Toxicity: | 0.277 |
Rat Oral Acute Toxicity: | 0.483 | Maximum Recommended Daily Dose: | 0.772 |
Skin Sensitization: | 0.852 | Carcinogencity: | 0.364 |
Eye Corrosion: | 0.917 | Eye Irritation: | 0.988 |
Respiratory Toxicity: | 0.954 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D06XMU | ![]() |
0.205 | ||||
![]() |
D0A2AJ | ![]() |
0.197 | ||||
![]() |
D03SKD | ![]() |
0.190 | ||||
![]() |
D0K0EK | ![]() |
0.190 | ||||
![]() |
D0R9VR | ![]() |
0.188 | ||||
![]() |
D0Z1XD | ![]() |
0.185 | ||||
![]() |
D04SFH | ![]() |
0.184 | ||||
![]() |
D0L1WV | ![]() |
0.183 | ||||
![]() |
D0K7LU | ![]() |
0.183 | ||||
![]() |
D03DIG | ![]() |
0.181 |