![]() |
Name |
asperthrin C
|
Molecular Formula | C27H31N3O6 | |
IUPAC Name* |
3-hydroxy-2-methoxy-9,9,16,16-tetramethyl-14-oxido-8-oxa-23,25-diaza-14-azoniaheptacyclo[17.5.2.01,17.03,15.04,13.07,12.019,23]hexacosa-4(13),5,7(12),10,14-pentaene-24,26-dione
|
|
SMILES |
COC1C2(O)C(=[N+]([O-])c3c2ccc2c3C=CC(C)(C)O2)C(C)(C)C2CC34CCCN3C(=O)C21NC4=O
|
|
InChI |
InChI=1S/C27H31N3O6/c1-23(2)11-9-14-16(36-23)8-7-15-18(14)30(34)19-24(3,4)17-13-25-10-6-12-29(25)22(32)26(17,28-21(25)31)20(35-5)27(15,19)33/h7-9,11,17,20,33H,6,10,12-13H2,1-5H3,(H,28,31)/t17-,20-,25+,26?,27?/m0/s1
|
|
InChIKey |
RGEKCJWSPYJSNC-IABLOUQZSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 493.56 | ALogp: | 2.0 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 114.2 | Aromatic Rings: | 8 |
Heavy Atoms: | 36 | QED Weighted: | 0.459 |
Caco-2 Permeability: | -5 | MDCK Permeability: | 0.00003100 |
Pgp-inhibitor: | 0.995 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.508 | 20% Bioavailability (F20%): | 0.13 |
30% Bioavailability (F30%): | 0.168 |
Blood-Brain-Barrier Penetration (BBB): | 0.759 | Plasma Protein Binding (PPB): | 83.45% |
Volume Distribution (VD): | 1.28 | Fu: | 14.46% |
CYP1A2-inhibitor: | 0.006 | CYP1A2-substrate: | 0.709 |
CYP2C19-inhibitor: | 0.152 | CYP2C19-substrate: | 0.915 |
CYP2C9-inhibitor: | 0.413 | CYP2C9-substrate: | 0.121 |
CYP2D6-inhibitor: | 0.13 | CYP2D6-substrate: | 0.095 |
CYP3A4-inhibitor: | 0.786 | CYP3A4-substrate: | 0.941 |
Clearance (CL): | 1.439 | Half-life (T1/2): | 0.099 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.849 |
Drug-inuced Liver Injury (DILI): | 0.895 | AMES Toxicity: | 0.59 |
Rat Oral Acute Toxicity: | 0.666 | Maximum Recommended Daily Dose: | 0.868 |
Skin Sensitization: | 0.033 | Carcinogencity: | 0.974 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.841 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004945 | ![]() |
1.000 | D03SKD | ![]() |
0.215 | ||
ENC004943 | ![]() |
0.739 | D0P0HT | ![]() |
0.213 | ||
ENC004071 | ![]() |
0.690 | D06YFA | ![]() |
0.211 | ||
ENC004072 | ![]() |
0.661 | D06HBQ | ![]() |
0.210 | ||
ENC002052 | ![]() |
0.622 | D05AFR | ![]() |
0.210 | ||
ENC004946 | ![]() |
0.621 | D06XZW | ![]() |
0.209 | ||
ENC004942 | ![]() |
0.619 | D0N0RU | ![]() |
0.207 | ||
ENC002704 | ![]() |
0.619 | D02JNM | ![]() |
0.207 | ||
ENC004948 | ![]() |
0.619 | D03ZZK | ![]() |
0.206 | ||
ENC002538 | ![]() |
0.612 | D0V4WD | ![]() |
0.205 |