![]() |
Name |
Amoenamide C
|
Molecular Formula | C27H31N3O5 | |
IUPAC Name* |
(1'R,2R,7'S,9'S,12'S)-12'-methoxy-7,7,10',10'-tetramethylspiro[1H-pyrano[2,3-g]indole-2,11'-3,13-diazatetracyclo[5.5.2.01,9.03,7]tetradecane]-2',3,14'-trione
|
|
SMILES |
CC1(C=CC2=C(O1)C=CC3=C2N[C@@]4(C3=O)[C@@H]([C@]56[C@H](C4(C)C)C[C@@]7(CCCN7C5=O)C(=O)N6)OC)C
|
|
InChI |
InChI=1S/C27H31N3O5/c1-23(2)11-9-14-16(35-23)8-7-15-18(14)28-27(19(15)31)20(34-5)26-17(24(27,3)4)13-25(21(32)29-26)10-6-12-30(25)22(26)33/h7-9,11,17,20,28H,6,10,12-13H2,1-5H3,(H,29,32)/t17-,20+,25-,26+,27-/m0/s1
|
|
InChIKey |
BWFJXZORBYERRQ-ZUZRYDNBSA-N
|
|
Synonyms |
Amoenamide C
|
|
CAS | NA | |
PubChem CID | 146682811 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 477.6 | ALogp: | 2.4 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 97.0 | Aromatic Rings: | 8 |
Heavy Atoms: | 35 | QED Weighted: | 0.644 |
Caco-2 Permeability: | -5.129 | MDCK Permeability: | 0.00002380 |
Pgp-inhibitor: | 0.989 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.164 | 20% Bioavailability (F20%): | 0.928 |
30% Bioavailability (F30%): | 0.961 |
Blood-Brain-Barrier Penetration (BBB): | 0.339 | Plasma Protein Binding (PPB): | 83.71% |
Volume Distribution (VD): | 1.085 | Fu: | 8.52% |
CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.245 |
CYP2C19-inhibitor: | 0.199 | CYP2C19-substrate: | 0.863 |
CYP2C9-inhibitor: | 0.736 | CYP2C9-substrate: | 0.057 |
CYP2D6-inhibitor: | 0.105 | CYP2D6-substrate: | 0.123 |
CYP3A4-inhibitor: | 0.931 | CYP3A4-substrate: | 0.914 |
Clearance (CL): | 5.359 | Half-life (T1/2): | 0.193 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.793 |
Drug-inuced Liver Injury (DILI): | 0.858 | AMES Toxicity: | 0.708 |
Rat Oral Acute Toxicity: | 0.882 | Maximum Recommended Daily Dose: | 0.941 |
Skin Sensitization: | 0.266 | Carcinogencity: | 0.971 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.436 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004071 | ![]() |
0.780 | D06YFA | ![]() |
0.213 | ||
ENC004946 | ![]() |
0.701 | D06HBQ | ![]() |
0.212 | ||
ENC002052 | ![]() |
0.690 | D03ZZK | ![]() |
0.209 | ||
ENC004945 | ![]() |
0.661 | D0C7JF | ![]() |
0.205 | ||
ENC004944 | ![]() |
0.661 | D06XZW | ![]() |
0.204 | ||
ENC002538 | ![]() |
0.636 | D00ETS | ![]() |
0.202 | ||
ENC002366 | ![]() |
0.629 | D02JNM | ![]() |
0.201 | ||
ENC002536 | ![]() |
0.629 | D02IQY | ![]() |
0.200 | ||
ENC002534 | ![]() |
0.629 | D03SKD | ![]() |
0.200 | ||
ENC004948 | ![]() |
0.602 | D0Q4SD | ![]() |
0.199 |