![]() |
Name |
diaporpenoid B
|
Molecular Formula | C23H32O3 | |
IUPAC Name* |
1,7,7,10,16-pentamethyl-2-oxatricyclo[10.8.0.014,19]icosa-3,5,9,14(19),15,17-hexaene-4,11-diol
|
|
SMILES |
CC1=CCC(C)(C)C=CCC2(C)Oc3cc(O)cc(C)c3CC2CC1O
|
|
InChI |
InChI=1S/C23H32O3/c1-15-7-10-22(3,4)8-6-9-23(5)17(13-20(15)25)12-19-16(2)11-18(24)14-21(19)26-23/h6-8,11,14,17,20,24-25H,9-10,12-13H2,1-5H3/b8-6+,15-7+/t17-,20-,23-/m1/s1
|
|
InChIKey |
QTNDIUYXNQSFIE-UVTPDJDRSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 356.51 | ALogp: | 5.1 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 49.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 26 | QED Weighted: | 0.611 |
Caco-2 Permeability: | -4.611 | MDCK Permeability: | 0.00002150 |
Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.955 |
30% Bioavailability (F30%): | 0.537 |
Blood-Brain-Barrier Penetration (BBB): | 0.324 | Plasma Protein Binding (PPB): | 97.65% |
Volume Distribution (VD): | 3.23 | Fu: | 2.34% |
CYP1A2-inhibitor: | 0.27 | CYP1A2-substrate: | 0.547 |
CYP2C19-inhibitor: | 0.335 | CYP2C19-substrate: | 0.8 |
CYP2C9-inhibitor: | 0.286 | CYP2C9-substrate: | 0.947 |
CYP2D6-inhibitor: | 0.71 | CYP2D6-substrate: | 0.919 |
CYP3A4-inhibitor: | 0.652 | CYP3A4-substrate: | 0.362 |
Clearance (CL): | 12.593 | Half-life (T1/2): | 0.157 |
hERG Blockers: | 0.047 | Human Hepatotoxicity (H-HT): | 0.655 |
Drug-inuced Liver Injury (DILI): | 0.022 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.833 |
Skin Sensitization: | 0.634 | Carcinogencity: | 0.348 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.084 |
Respiratory Toxicity: | 0.422 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001963 | ![]() |
1.000 | D0P1FO | ![]() |
0.250 | ||
ENC002088 | ![]() |
0.388 | D0L7AS | ![]() |
0.239 | ||
ENC004937 | ![]() |
0.348 | D0N0RU | ![]() |
0.237 | ||
ENC005684 | ![]() |
0.325 | D07MGA | ![]() |
0.222 | ||
ENC004150 | ![]() |
0.324 | D0W2EK | ![]() |
0.213 | ||
ENC003231 | ![]() |
0.302 | D0D2TN | ![]() |
0.210 | ||
ENC002560 | ![]() |
0.301 | D0W6DG | ![]() |
0.206 | ||
ENC004898 | ![]() |
0.287 | D02JNM | ![]() |
0.205 | ||
ENC003164 | ![]() |
0.287 | D0Z1FX | ![]() |
0.204 | ||
ENC002750 | ![]() |
0.286 | D0R9VR | ![]() |
0.202 |