|
Name |
gliocladicillin A
|
Molecular Formula | C31H30N6O5S4 | |
IUPAC Name* |
3-[14-(1-hydroxyethyl)-18-methyl-13,17-dioxo-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-trien-3-yl]-14,18-dimethyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione
|
|
SMILES |
CC(O)C12SSC3(CC4(C56CC78SSC(C)(C(=O)N7C5Nc5ccccc56)N(C)C8=O)c5ccccc5NC4N3C1=O)C(=O)N2C
|
|
InChI |
InChI=1S/C31H30N6O5S4/c1-15(38)31-25(42)37-21-28(17-10-6-8-12-19(17)33-21,14-30(37,45-46-31)24(41)35(31)4)27-13-29-23(40)34(3)26(2,43-44-29)22(39)36(29)20(27)32-18-11-7-5-9-16(18)27/h5-12,15,20-21,32-33,38H,13-14H2,1-4H3/t15?,20-,21-,26+,27+,28+,29+,30+,31+/m1/s1
|
|
InChIKey |
OXNLCXNSBGGFTK-YBLGTFNASA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 694.89 | ALogp: | 2.8 |
HBD: | 3 | HBA: | 11 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 125.5 | Aromatic Rings: | 12 |
Heavy Atoms: | 46 | QED Weighted: | 0.4 |
Caco-2 Permeability: | -5.372 | MDCK Permeability: | 0.00001950 |
Pgp-inhibitor: | 0.997 | Pgp-substrate: | 0.012 |
Human Intestinal Absorption (HIA): | 0.911 | 20% Bioavailability (F20%): | 0.957 |
30% Bioavailability (F30%): | 0.973 |
Blood-Brain-Barrier Penetration (BBB): | 0.084 | Plasma Protein Binding (PPB): | 87.77% |
Volume Distribution (VD): | 0.755 | Fu: | 10.26% |
CYP1A2-inhibitor: | 0.008 | CYP1A2-substrate: | 0.404 |
CYP2C19-inhibitor: | 0.979 | CYP2C19-substrate: | 0.969 |
CYP2C9-inhibitor: | 0.987 | CYP2C9-substrate: | 0.244 |
CYP2D6-inhibitor: | 0.569 | CYP2D6-substrate: | 0.052 |
CYP3A4-inhibitor: | 0.979 | CYP3A4-substrate: | 0.993 |
Clearance (CL): | 6.596 | Half-life (T1/2): | 0.001 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.141 |
Drug-inuced Liver Injury (DILI): | 0.97 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.988 | Maximum Recommended Daily Dose: | 0.211 |
Skin Sensitization: | 0.462 | Carcinogencity: | 0.258 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.003 |
Respiratory Toxicity: | 0.02 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001500 | 0.874 | D09NNH | 0.236 | ||||
ENC003381 | 0.669 | D01TSI | 0.235 | ||||
ENC004849 | 0.596 | D0SP3D | 0.230 | ||||
ENC003490 | 0.589 | D0V3ZA | 0.229 | ||||
ENC003176 | 0.586 | D0E0RY | 0.224 | ||||
ENC003382 | 0.576 | D0V9WF | 0.224 | ||||
ENC003588 | 0.565 | D0K4CQ | 0.213 | ||||
ENC003530 | 0.493 | D0W7RJ | 0.210 | ||||
ENC003455 | 0.466 | D03KQF | 0.209 | ||||
ENC002358 | 0.461 | D0U8UV | 0.208 |