![]() |
Name |
bionectin B
|
Molecular Formula | C24H22N4O4S2 | |
IUPAC Name* |
(1S,2S,3R,11R,14S)-2-hydroxy-14-(1-hydroxyethyl)-3-(1H-indol-3-yl)-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione
|
|
SMILES |
CC([C@]12C(=O)N3[C@@H]4[C@]([C@@H]([C@@]3(C(=O)N1C)SS2)O)(C5=CC=CC=C5N4)C6=CNC7=CC=CC=C76)O
|
|
InChI |
InChI=1S/C24H22N4O4S2/c1-12(29)23-21(32)28-19-22(14-8-4-6-10-17(14)26-19,15-11-25-16-9-5-3-7-13(15)16)18(30)24(28,34-33-23)20(31)27(23)2/h3-12,18-19,25-26,29-30H,1-2H3/t12?,18-,19+,22+,23-,24-/m0/s1
|
|
InChIKey |
RXMWCUHVQJFPOO-SOUSOVJZSA-N
|
|
Synonyms |
bionectin B; CHEMBL517479; (1S,2S,3R,11R,14S)-2-hydroxy-14-(1-hydroxyethyl)-3-(1H-indol-3-yl)-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione
|
|
CAS | NA | |
PubChem CID | 16099559 | |
ChEMBL ID | CHEMBL517479 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 494.6 | ALogp: | 2.3 |
HBD: | 4 | HBA: | 7 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 160.0 | Aromatic Rings: | 8 |
Heavy Atoms: | 34 | QED Weighted: | 0.406 |
Caco-2 Permeability: | -5.569 | MDCK Permeability: | 0.00000624 |
Pgp-inhibitor: | 0.019 | Pgp-substrate: | 0.133 |
Human Intestinal Absorption (HIA): | 0.021 | 20% Bioavailability (F20%): | 0.046 |
30% Bioavailability (F30%): | 0.927 |
Blood-Brain-Barrier Penetration (BBB): | 0.314 | Plasma Protein Binding (PPB): | 83.66% |
Volume Distribution (VD): | 0.811 | Fu: | 10.45% |
CYP1A2-inhibitor: | 0.059 | CYP1A2-substrate: | 0.178 |
CYP2C19-inhibitor: | 0.945 | CYP2C19-substrate: | 0.913 |
CYP2C9-inhibitor: | 0.963 | CYP2C9-substrate: | 0.887 |
CYP2D6-inhibitor: | 0.498 | CYP2D6-substrate: | 0.133 |
CYP3A4-inhibitor: | 0.928 | CYP3A4-substrate: | 0.968 |
Clearance (CL): | 8.825 | Half-life (T1/2): | 0.077 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.112 |
Drug-inuced Liver Injury (DILI): | 0.978 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.939 | Maximum Recommended Daily Dose: | 0.628 |
Skin Sensitization: | 0.772 | Carcinogencity: | 0.589 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.173 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003992 | ![]() |
0.810 | D09NNH | ![]() |
0.287 | ||
ENC003530 | ![]() |
0.609 | D0V3ZA | ![]() |
0.281 | ||
ENC003381 | ![]() |
0.527 | D01TSI | ![]() |
0.281 | ||
ENC004849 | ![]() |
0.516 | D0QV5T | ![]() |
0.279 | ||
ENC003490 | ![]() |
0.510 | D0E3OF | ![]() |
0.278 | ||
ENC004848 | ![]() |
0.461 | D0BV3J | ![]() |
0.275 | ||
ENC003176 | ![]() |
0.445 | D0SP3D | ![]() |
0.272 | ||
ENC003382 | ![]() |
0.437 | D08FTG | ![]() |
0.272 | ||
ENC003588 | ![]() |
0.429 | D0E4DW | ![]() |
0.269 | ||
ENC006112 | ![]() |
0.388 | D0J5YC | ![]() |
0.267 |