![]() |
Name |
1,2-dehydro-terredehydroaustin
|
Molecular Formula | C33H42O11 | |
IUPAC Name* |
[16-acetyloxy-5-(2-formyloxypropan-2-yl)-2,9,13-trimethyl-6,15-dimethylidene-11,14-dioxo-5-propyl-10,12,16-trioxapentacyclo[7.5.1.17,13.01,7.02,7]hexadecan-3-yl]2-methylbut-2-enoate
|
|
SMILES |
C=C1C(CCC)(C(C)(C)OC=O)CC(OC(=O)C(C)=CC)C2(C)C13OC14C(=O)OC(C)(C(=C)C12C(=O)OC4C)C3OC(C)=O
|
|
InChI |
InChI=1S/C33H42O11/c1-12-14-30(27(8,9)39-16-34)15-22(42-23(36)17(3)13-2)29(11)31-18(4)28(10)24(41-21(7)35)32(29,19(30)5)44-33(31,26(38)43-28)20(6)40-25(31)37/h13,16,20,22,24H,4-5,12,14-15H2,1-3,6-11H3/b17-13-/t20-,22-,24-,28+,29-,30+,31+,32+,33-/m1/s1
|
|
InChIKey |
VETYXIYYGGXWPV-SBSKQAIXSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 614.69 | ALogp: | 3.8 |
HBD: | 0 | HBA: | 11 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 140.7 | Aromatic Rings: | 5 |
Heavy Atoms: | 44 | QED Weighted: | 0.126 |
Caco-2 Permeability: | -5.187 | MDCK Permeability: | 0.00001920 |
Pgp-inhibitor: | 0.993 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.697 | 20% Bioavailability (F20%): | 0.983 |
30% Bioavailability (F30%): | 0.973 |
Blood-Brain-Barrier Penetration (BBB): | 0.206 | Plasma Protein Binding (PPB): | 70.22% |
Volume Distribution (VD): | 2.23 | Fu: | 29.08% |
CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.959 |
CYP2C19-inhibitor: | 0.441 | CYP2C19-substrate: | 0.925 |
CYP2C9-inhibitor: | 0.526 | CYP2C9-substrate: | 0.032 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.061 |
CYP3A4-inhibitor: | 0.89 | CYP3A4-substrate: | 0.928 |
Clearance (CL): | 2.706 | Half-life (T1/2): | 0.007 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.554 |
Drug-inuced Liver Injury (DILI): | 0.95 | AMES Toxicity: | 0.96 |
Rat Oral Acute Toxicity: | 0.976 | Maximum Recommended Daily Dose: | 0.017 |
Skin Sensitization: | 0.013 | Carcinogencity: | 0.982 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.061 |
Respiratory Toxicity: | 0.623 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004812 | ![]() |
0.882 | D0H2MO | ![]() |
0.241 | ||
ENC004811 | ![]() |
0.736 | D0E9KA | ![]() |
0.230 | ||
ENC006041 | ![]() |
0.667 | D0KR9U | ![]() |
0.228 | ||
ENC003179 | ![]() |
0.574 | D02HSB | ![]() |
0.203 | ||
ENC003159 | ![]() |
0.574 | D0G7KJ | ![]() |
0.201 | ||
ENC003776 | ![]() |
0.574 | D09SIK | ![]() |
0.200 | ||
ENC005316 | ![]() |
0.574 | D0OL7F | ![]() |
0.200 | ||
ENC004311 | ![]() |
0.566 | D0O5WP | ![]() |
0.197 | ||
ENC005315 | ![]() |
0.497 | D07QQD | ![]() |
0.197 | ||
ENC003309 | ![]() |
0.452 | D01ZOG | ![]() |
0.197 |