![]() |
Name |
Alternariainol D
|
Molecular Formula | C24H24O6 | |
IUPAC Name* |
3-[5-[(4-hydroxy-1,3-dihydro-2-benzofuran-1-yl)methyl]-3,6-dimethyl-1,4-dioxin-2-yl]-3,4-dihydro-1H-isochromen-8-ol
|
|
SMILES |
CC1=C(CC2OCc3c(O)cccc32)OC(C)=C(C2Cc3cccc(O)c3CO2)O1
|
|
InChI |
InChI=1S/C24H24O6/c1-13-21(10-22-16-6-4-8-20(26)18(16)12-27-22)29-14(2)24(30-13)23-9-15-5-3-7-19(25)17(15)11-28-23/h3-8,22-23,25-26H,9-12H2,1-2H3
|
|
InChIKey |
YYOPTRDZRLDXFI-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 408.45 | ALogp: | 4.7 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 77.4 | Aromatic Rings: | 5 |
Heavy Atoms: | 30 | QED Weighted: | 0.732 |
Caco-2 Permeability: | -4.855 | MDCK Permeability: | 0.00001670 |
Pgp-inhibitor: | 0.3 | Pgp-substrate: | 0.967 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.026 |
30% Bioavailability (F30%): | 0.263 |
Blood-Brain-Barrier Penetration (BBB): | 0.047 | Plasma Protein Binding (PPB): | 86.06% |
Volume Distribution (VD): | 0.91 | Fu: | 10.12% |
CYP1A2-inhibitor: | 0.496 | CYP1A2-substrate: | 0.11 |
CYP2C19-inhibitor: | 0.448 | CYP2C19-substrate: | 0.234 |
CYP2C9-inhibitor: | 0.264 | CYP2C9-substrate: | 0.187 |
CYP2D6-inhibitor: | 0.658 | CYP2D6-substrate: | 0.717 |
CYP3A4-inhibitor: | 0.555 | CYP3A4-substrate: | 0.484 |
Clearance (CL): | 11.186 | Half-life (T1/2): | 0.873 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.076 |
Drug-inuced Liver Injury (DILI): | 0.69 | AMES Toxicity: | 0.751 |
Rat Oral Acute Toxicity: | 0.413 | Maximum Recommended Daily Dose: | 0.121 |
Skin Sensitization: | 0.934 | Carcinogencity: | 0.046 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.695 |
Respiratory Toxicity: | 0.189 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004565 | ![]() |
0.955 | D0H6QU | ![]() |
0.277 | ||
ENC004564 | ![]() |
0.703 | D09OQV | ![]() |
0.271 | ||
ENC004569 | ![]() |
0.402 | D0R6BI | ![]() |
0.229 | ||
ENC005673 | ![]() |
0.308 | D02TJS | ![]() |
0.227 | ||
ENC005674 | ![]() |
0.308 | D03DJL | ![]() |
0.226 | ||
ENC001944 | ![]() |
0.299 | D07MGA | ![]() |
0.225 | ||
ENC004303 | ![]() |
0.297 | D05AFX | ![]() |
0.224 | ||
ENC002854 | ![]() |
0.286 | D05MQK | ![]() |
0.223 | ||
ENC004888 | ![]() |
0.283 | D05HSC | ![]() |
0.223 | ||
ENC000087 | ![]() |
0.283 | D00JRA | ![]() |
0.220 |