![]() |
Name |
Alternariainol C
|
Molecular Formula | C24H24O6 | |
IUPAC Name* |
3-[6-[(4-hydroxy-1,3-dihydro-2-benzofuran-1-yl)methyl]-3,5-dimethyl-1,4-dioxin-2-yl]-3,4-dihydro-1H-isochromen-8-ol
|
|
SMILES |
CC1=C(CC2OCc3c(O)cccc32)OC(C2Cc3cccc(O)c3CO2)=C(C)O1
|
|
InChI |
InChI=1S/C24H24O6/c1-13-21(10-22-16-6-4-8-20(26)18(16)12-27-22)30-24(14(2)29-13)23-9-15-5-3-7-19(25)17(15)11-28-23/h3-8,22-23,25-26H,9-12H2,1-2H3
|
|
InChIKey |
YHDQICLHIVZCKC-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 408.45 | ALogp: | 4.7 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 77.4 | Aromatic Rings: | 5 |
Heavy Atoms: | 30 | QED Weighted: | 0.732 |
Caco-2 Permeability: | -4.854 | MDCK Permeability: | 0.00001650 |
Pgp-inhibitor: | 0.3 | Pgp-substrate: | 0.968 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.025 |
30% Bioavailability (F30%): | 0.298 |
Blood-Brain-Barrier Penetration (BBB): | 0.047 | Plasma Protein Binding (PPB): | 86.16% |
Volume Distribution (VD): | 0.923 | Fu: | 10.24% |
CYP1A2-inhibitor: | 0.52 | CYP1A2-substrate: | 0.111 |
CYP2C19-inhibitor: | 0.445 | CYP2C19-substrate: | 0.208 |
CYP2C9-inhibitor: | 0.3 | CYP2C9-substrate: | 0.184 |
CYP2D6-inhibitor: | 0.663 | CYP2D6-substrate: | 0.7 |
CYP3A4-inhibitor: | 0.567 | CYP3A4-substrate: | 0.491 |
Clearance (CL): | 11.112 | Half-life (T1/2): | 0.858 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.085 |
Drug-inuced Liver Injury (DILI): | 0.697 | AMES Toxicity: | 0.751 |
Rat Oral Acute Toxicity: | 0.414 | Maximum Recommended Daily Dose: | 0.12 |
Skin Sensitization: | 0.932 | Carcinogencity: | 0.045 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.649 |
Respiratory Toxicity: | 0.225 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004566 | ![]() |
0.955 | D0H6QU | ![]() |
0.277 | ||
ENC004564 | ![]() |
0.720 | D09OQV | ![]() |
0.271 | ||
ENC004569 | ![]() |
0.402 | D0R6BI | ![]() |
0.229 | ||
ENC005673 | ![]() |
0.308 | D02TJS | ![]() |
0.227 | ||
ENC005674 | ![]() |
0.308 | D03DJL | ![]() |
0.226 | ||
ENC001944 | ![]() |
0.299 | D07MGA | ![]() |
0.225 | ||
ENC004303 | ![]() |
0.297 | D05AFX | ![]() |
0.224 | ||
ENC002854 | ![]() |
0.286 | D05MQK | ![]() |
0.223 | ||
ENC004888 | ![]() |
0.283 | D05HSC | ![]() |
0.223 | ||
ENC000087 | ![]() |
0.283 | D00JRA | ![]() |
0.220 |