![]() |
Name |
Pestalotheol O
|
Molecular Formula | C18H26O6 | |
IUPAC Name* |
NA
|
|
SMILES |
CC(=C)C=C=C1C[C@H]2[C@@](C[C@@H](O2)C(C)(C)O)([C@H]([C@@H]1O)OC(=O)C)O
|
|
InChI |
InChI=1S/C18H26O6/c1-10(2)6-7-12-8-13-18(22,9-14(24-13)17(4,5)21)16(15(12)20)23-11(3)19/h6,13-16,20-22H,1,8-9H2,2-5H3/t7?,13-,14+,15+,16-,18-/m0/s1
|
|
InChIKey |
UDGGWZAIZWVIEQ-UROALPJMSA-N
|
|
Synonyms |
Pestalotheol O
|
|
CAS | NA | |
PubChem CID | 156581919 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 338.4 | ALogp: | 0.0 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 96.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 24 | QED Weighted: | 0.409 |
Caco-2 Permeability: | -4.706 | MDCK Permeability: | 0.00005150 |
Pgp-inhibitor: | 0.169 | Pgp-substrate: | 0.056 |
Human Intestinal Absorption (HIA): | 0.066 | 20% Bioavailability (F20%): | 0.02 |
30% Bioavailability (F30%): | 0.292 |
Blood-Brain-Barrier Penetration (BBB): | 0.354 | Plasma Protein Binding (PPB): | 51.10% |
Volume Distribution (VD): | 1.256 | Fu: | 55.74% |
CYP1A2-inhibitor: | 0.009 | CYP1A2-substrate: | 0.04 |
CYP2C19-inhibitor: | 0.016 | CYP2C19-substrate: | 0.192 |
CYP2C9-inhibitor: | 0.006 | CYP2C9-substrate: | 0.064 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.081 |
CYP3A4-inhibitor: | 0.016 | CYP3A4-substrate: | 0.11 |
Clearance (CL): | 2.237 | Half-life (T1/2): | 0.649 |
hERG Blockers: | 0.034 | Human Hepatotoxicity (H-HT): | 0.422 |
Drug-inuced Liver Injury (DILI): | 0.126 | AMES Toxicity: | 0.364 |
Rat Oral Acute Toxicity: | 0.904 | Maximum Recommended Daily Dose: | 0.903 |
Skin Sensitization: | 0.95 | Carcinogencity: | 0.82 |
Eye Corrosion: | 0.014 | Eye Irritation: | 0.29 |
Respiratory Toxicity: | 0.957 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004437 | ![]() |
0.710 | D0H2MO | ![]() |
0.234 | ||
ENC004336 | ![]() |
0.710 | D0X7XG | ![]() |
0.209 | ||
ENC004975 | ![]() |
0.603 | D0E9KA | ![]() |
0.198 | ||
ENC004332 | ![]() |
0.513 | D05BTM | ![]() |
0.198 | ||
ENC004328 | ![]() |
0.513 | D0T6WT | ![]() |
0.198 | ||
ENC004323 | ![]() |
0.433 | D0KR9U | ![]() |
0.193 | ||
ENC004335 | ![]() |
0.405 | D0F7NQ | ![]() |
0.192 | ||
ENC004334 | ![]() |
0.405 | D09WYX | ![]() |
0.189 | ||
ENC004338 | ![]() |
0.398 | D0H0ND | ![]() |
0.189 | ||
ENC002505 | ![]() |
0.391 | D0T2PL | ![]() |
0.189 |