![]() |
Name |
Pestalotheol I
|
Molecular Formula | C16H24O5 | |
IUPAC Name* |
1-[(2R,3aR,4S,7aS)-3a,4-dihydroxy-2-(2-hydroxypropan-2-yl)-3,4,7,7a-tetrahydro-2H-1-benzofuran-6-yl]-3-methylbut-2-en-1-one
|
|
SMILES |
CC(=CC(=O)C1=C[C@@H]([C@@]2(C[C@@H](O[C@H]2C1)C(C)(C)O)O)O)C
|
|
InChI |
InChI=1S/C16H24O5/c1-9(2)5-11(17)10-6-12(18)16(20)8-14(15(3,4)19)21-13(16)7-10/h5-6,12-14,18-20H,7-8H2,1-4H3/t12-,13-,14+,16+/m0/s1
|
|
InChIKey |
VLKFKGJJMGLYDL-TTZDDIAXSA-N
|
|
Synonyms |
Pestalotheol I
|
|
CAS | NA | |
PubChem CID | 156581909 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 296.36 | ALogp: | 0.4 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.683 |
Caco-2 Permeability: | -4.639 | MDCK Permeability: | 0.00002120 |
Pgp-inhibitor: | 0.012 | Pgp-substrate: | 0.368 |
Human Intestinal Absorption (HIA): | 0.019 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.018 |
Blood-Brain-Barrier Penetration (BBB): | 0.91 | Plasma Protein Binding (PPB): | 58.44% |
Volume Distribution (VD): | 1.191 | Fu: | 40.82% |
CYP1A2-inhibitor: | 0.01 | CYP1A2-substrate: | 0.202 |
CYP2C19-inhibitor: | 0.038 | CYP2C19-substrate: | 0.816 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.147 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.18 |
CYP3A4-inhibitor: | 0.021 | CYP3A4-substrate: | 0.467 |
Clearance (CL): | 6.917 | Half-life (T1/2): | 0.688 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.138 |
Drug-inuced Liver Injury (DILI): | 0.171 | AMES Toxicity: | 0.637 |
Rat Oral Acute Toxicity: | 0.263 | Maximum Recommended Daily Dose: | 0.934 |
Skin Sensitization: | 0.396 | Carcinogencity: | 0.864 |
Eye Corrosion: | 0.011 | Eye Irritation: | 0.369 |
Respiratory Toxicity: | 0.873 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D07QKN | ![]() |
0.208 | ||||
![]() |
D0E9KA | ![]() |
0.202 | ||||
![]() |
D0P0HT | ![]() |
0.198 | ||||
![]() |
D0F7NQ | ![]() |
0.195 | ||||
![]() |
D0F1EX | ![]() |
0.193 | ||||
![]() |
D0H0ND | ![]() |
0.191 | ||||
![]() |
D0W6DG | ![]() |
0.189 | ||||
![]() |
D0O5NK | ![]() |
0.188 | ||||
![]() |
D08PIQ | ![]() |
0.185 | ||||
![]() |
D07VFD | ![]() |
0.185 |