![]() |
Name |
Chaetoviridin K
|
Molecular Formula | C23H27ClO7 | |
IUPAC Name* |
(1S,10S,12R,13R,14R,17R)-8-chloro-12-hydroxy-5-(3-hydroxy-3-methylpent-1-enyl)-10,13,14-trimethyl-4,11,15-trioxatetracyclo[8.7.0.02,7.012,17]heptadeca-2,5,7-triene-9,16-dione
|
|
SMILES |
CCC(C)(C=CC1=CC2=C(C(=O)[C@@]3([C@H](C2=CO1)[C@H]4C(=O)O[C@@H]([C@H]([C@]4(O3)O)C)C)C)Cl)O
|
|
InChI |
InChI=1S/C23H27ClO7/c1-6-21(4,27)8-7-13-9-14-15(10-29-13)16-17-20(26)30-12(3)11(2)23(17,28)31-22(16,5)19(25)18(14)24/h7-12,16-17,27-28H,6H2,1-5H3/t11-,12-,16-,17+,21?,22+,23-/m1/s1
|
|
InChIKey |
AHSSGPXZWGCGLY-ITCBJJPFSA-N
|
|
Synonyms |
Chaetoviridin K
|
|
CAS | NA | |
PubChem CID | 156580446 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 450.9 | ALogp: | 1.9 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 102.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 31 | QED Weighted: | 0.632 |
Caco-2 Permeability: | -4.684 | MDCK Permeability: | 0.00001690 |
Pgp-inhibitor: | 0.027 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.081 | 20% Bioavailability (F20%): | 0.895 |
30% Bioavailability (F30%): | 0.929 |
Blood-Brain-Barrier Penetration (BBB): | 0.986 | Plasma Protein Binding (PPB): | 76.07% |
Volume Distribution (VD): | 1.922 | Fu: | 18.26% |
CYP1A2-inhibitor: | 0.551 | CYP1A2-substrate: | 0.539 |
CYP2C19-inhibitor: | 0.544 | CYP2C19-substrate: | 0.718 |
CYP2C9-inhibitor: | 0.29 | CYP2C9-substrate: | 0.015 |
CYP2D6-inhibitor: | 0.356 | CYP2D6-substrate: | 0.022 |
CYP3A4-inhibitor: | 0.91 | CYP3A4-substrate: | 0.748 |
Clearance (CL): | 7.743 | Half-life (T1/2): | 0.14 |
hERG Blockers: | 0.194 | Human Hepatotoxicity (H-HT): | 0.958 |
Drug-inuced Liver Injury (DILI): | 0.774 | AMES Toxicity: | 0.062 |
Rat Oral Acute Toxicity: | 0.937 | Maximum Recommended Daily Dose: | 0.891 |
Skin Sensitization: | 0.923 | Carcinogencity: | 0.829 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.022 |
Respiratory Toxicity: | 0.982 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002532 | ![]() |
0.783 | D0G6AB | ![]() |
0.208 | ||
ENC002501 | ![]() |
0.747 | D0KR9U | ![]() |
0.206 | ||
ENC002533 | ![]() |
0.637 | D0I5DS | ![]() |
0.200 | ||
ENC005231 | ![]() |
0.505 | D0K7LU | ![]() |
0.200 | ||
ENC002529 | ![]() |
0.473 | D0C1SF | ![]() |
0.194 | ||
ENC002613 | ![]() |
0.438 | D0C8HR | ![]() |
0.191 | ||
ENC002611 | ![]() |
0.417 | D02GAC | ![]() |
0.190 | ||
ENC001876 | ![]() |
0.387 | D0J2NK | ![]() |
0.190 | ||
ENC005844 | ![]() |
0.377 | D0R6RC | ![]() |
0.190 | ||
ENC005878 | ![]() |
0.377 | D02IQY | ![]() |
0.188 |