|
Name |
chaetomugilin D
|
Molecular Formula | C23H27ClO6 | |
IUPAC Name* |
(1S,10S,12R,13R,14R,17R)-8-chloro-12-hydroxy-10,13,14-trimethyl-5-[(E,3S)-3-methylpent-1-enyl]-4,11,15-trioxatetracyclo[8.7.0.02,7.012,17]heptadeca-2,5,7-triene-9,16-dione
|
|
SMILES |
CC[C@H](C)/C=C/C1=CC2=C(C(=O)[C@@]3([C@H](C2=CO1)[C@H]4C(=O)O[C@@H]([C@H]([C@]4(O3)O)C)C)C)Cl
|
|
InChI |
InChI=1S/C23H27ClO6/c1-6-11(2)7-8-14-9-15-16(10-28-14)17-18-21(26)29-13(4)12(3)23(18,27)30-22(17,5)20(25)19(15)24/h7-13,17-18,27H,6H2,1-5H3/b8-7+/t11-,12+,13+,17+,18-,22-,23+/m0/s1
|
|
InChIKey |
VFAOIGZBHFMFIU-XSKLMDGHSA-N
|
|
Synonyms |
chaetomugilin D; CHEBI:68730; 1098081-38-9; CHEMBL494745; DTXSID201098682; Q27137149; (1S,10S,12R,13R,14R,17R)-8-chloro-12-hydroxy-10,13,14-trimethyl-5-[(E,3S)-3-methylpent-1-enyl]-4,11,15-trioxatetracyclo[8.7.0.02,7.012,17]heptadeca-2,5,7-triene-9,16-dione; (6aS,7aR,8R,9R,11aR,11bS)-5-Chloro-6a,7a,8,9,11a,11b-hexahydro-7a-hydroxy-6a,8,9-trimethyl-3-[(1E,3S)-3-methyl-1-penten-1-yl]-6H,11H-pyrano[3',4':4,5]furo[2,3-h]-2-benzopyran-6,11-dione; (6aS,7aR,8R,9R,11aR,11bS)-5-chloro-7a-hydroxy-6a,8,9-trimethyl-3-[(1E,3S)-3-methylpent-1-en-1-yl]-6a,7a,8,9,11a,11b-hexahydro-6H,11H-pyrano[3',4':4,5]furo[2,3-h]isochromene-6,11-dione
|
|
CAS | 1098081-38-9 | |
PubChem CID | 25148534 | |
ChEMBL ID | CHEMBL494745 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 434.9 | ALogp: | 3.3 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 82.1 | Aromatic Rings: | 4 |
Heavy Atoms: | 30 | QED Weighted: | 0.661 |
Caco-2 Permeability: | -4.612 | MDCK Permeability: | 0.00001400 |
Pgp-inhibitor: | 0.009 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.12 |
30% Bioavailability (F30%): | 0.907 |
Blood-Brain-Barrier Penetration (BBB): | 0.99 | Plasma Protein Binding (PPB): | 78.01% |
Volume Distribution (VD): | 2.427 | Fu: | 17.31% |
CYP1A2-inhibitor: | 0.933 | CYP1A2-substrate: | 0.472 |
CYP2C19-inhibitor: | 0.807 | CYP2C19-substrate: | 0.721 |
CYP2C9-inhibitor: | 0.717 | CYP2C9-substrate: | 0.029 |
CYP2D6-inhibitor: | 0.716 | CYP2D6-substrate: | 0.051 |
CYP3A4-inhibitor: | 0.939 | CYP3A4-substrate: | 0.511 |
Clearance (CL): | 6.365 | Half-life (T1/2): | 0.061 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.974 |
Drug-inuced Liver Injury (DILI): | 0.935 | AMES Toxicity: | 0.309 |
Rat Oral Acute Toxicity: | 0.858 | Maximum Recommended Daily Dose: | 0.871 |
Skin Sensitization: | 0.927 | Carcinogencity: | 0.843 |
Eye Corrosion: | 0.018 | Eye Irritation: | 0.055 |
Respiratory Toxicity: | 0.984 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002501 | 0.822 | D0K7LU | 0.204 | ||||
ENC002533 | 0.813 | D0G6AB | 0.202 | ||||
ENC004258 | 0.783 | D0C1SF | 0.197 | ||||
ENC005231 | 0.634 | D0I5DS | 0.194 | ||||
ENC002529 | 0.616 | D0C8HR | 0.185 | ||||
ENC002613 | 0.574 | D02GAC | 0.185 | ||||
ENC002612 | 0.500 | D0D2TN | 0.185 | ||||
ENC005844 | 0.490 | D0J2NK | 0.184 | ||||
ENC005878 | 0.490 | D0R6RC | 0.184 | ||||
ENC002611 | 0.477 | D06WTZ | 0.184 |