![]() |
Name |
(1R,4S,4'Z,5'S,6R,6'S,8R,13R,20R,21R,24S)-21,24-dihydroxy-4'-methoxyimino-5',11,13,22-tetramethyl-6'-[(E)-4-methylpent-2-en-2-yl]spiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one
|
Molecular Formula | C37H53NO8 | |
IUPAC Name* |
(1R,4S,4'Z,5'S,6R,6'S,8R,13R,20R,21R,24S)-21,24-dihydroxy-4'-methoxyimino-5',11,13,22-tetramethyl-6'-[(E)-4-methylpent-2-en-2-yl]spiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one
|
|
SMILES |
C[C@@H]1CC(=CC[C@@H]2C[C@@H](C[C@@]3(O2)C/C(=N/OC)/[C@@H]([C@H](O3)/C(=C/C(C)C)/C)C)OC(=O)[C@@H]4C=C([C@H]([C@@H]5[C@]4(C(=CC=C1)CO5)O)O)C)C
|
|
InChI |
InChI=1S/C37H53NO8/c1-21(2)14-25(6)33-26(7)31(38-42-8)19-36(46-33)18-29-17-28(45-36)13-12-23(4)15-22(3)10-9-11-27-20-43-34-32(39)24(5)16-30(35(40)44-29)37(27,34)41/h9-12,14,16,21-22,26,28-30,32-34,39,41H,13,15,17-20H2,1-8H3/b10-9?,23-12?,25-14+,27-11?,38-31-/t22-,26-,28+,29-,30-,32+,33+,34+,36-,37+/m0/s1
|
|
InChIKey |
YZBLFMPOMVTDJY-JLOCULIASA-N
|
|
Synonyms |
Moxidectin; 113507-06-5
|
|
CAS | 113507-06-5 | |
PubChem CID | 154825546 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 639.8 | ALogp: | 4.3 |
HBD: | 2 | HBA: | 9 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 116.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 46 | QED Weighted: | 0.224 |
Caco-2 Permeability: | -4.707 | MDCK Permeability: | 0.00005170 |
Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.997 |
Human Intestinal Absorption (HIA): | 0.276 | 20% Bioavailability (F20%): | 0.031 |
30% Bioavailability (F30%): | 0.957 |
Blood-Brain-Barrier Penetration (BBB): | 0.081 | Plasma Protein Binding (PPB): | 94.79% |
Volume Distribution (VD): | 2.102 | Fu: | 6.16% |
CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.055 |
CYP2C19-inhibitor: | 0.016 | CYP2C19-substrate: | 0.818 |
CYP2C9-inhibitor: | 0.033 | CYP2C9-substrate: | 0.017 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.138 |
CYP3A4-inhibitor: | 0.597 | CYP3A4-substrate: | 0.799 |
Clearance (CL): | 3.215 | Half-life (T1/2): | 0.013 |
hERG Blockers: | 0.234 | Human Hepatotoxicity (H-HT): | 0.984 |
Drug-inuced Liver Injury (DILI): | 0.968 | AMES Toxicity: | 0.966 |
Rat Oral Acute Toxicity: | 0.247 | Maximum Recommended Daily Dose: | 0.998 |
Skin Sensitization: | 0.866 | Carcinogencity: | 0.059 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.968 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003310 | ![]() |
0.271 | D09YHJ | ![]() |
0.451 | ||
ENC003173 | ![]() |
0.261 | D03LJR | ![]() |
0.267 | ||
ENC003155 | ![]() |
0.257 | D0K3QS | ![]() |
0.257 | ||
ENC004753 | ![]() |
0.253 | D0V7WS | ![]() |
0.253 | ||
ENC004852 | ![]() |
0.249 | D08NLN | ![]() |
0.251 | ||
ENC003260 | ![]() |
0.247 | D0ES1Q | ![]() |
0.250 | ||
ENC002049 | ![]() |
0.241 | D0Z4UN | ![]() |
0.240 | ||
ENC003851 | ![]() |
0.241 | D06OMK | ![]() |
0.237 | ||
ENC002050 | ![]() |
0.240 | D0W2EK | ![]() |
0.235 | ||
ENC005320 | ![]() |
0.237 | D05CHI | ![]() |
0.227 |