![]() |
Name |
12,13-deoxyroridin E
|
Molecular Formula | C29H38O7 | |
IUPAC Name* |
(1R,3R,8R,12E,17R,18E,20Z,24R,25S)-17-[(1R)-1-hydroxyethyl]-5,13,25-trimethyl-26-methylidene-2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,12,18,20-tetraene-11,22-dione
|
|
SMILES |
CC1=C[C@@H]2[C@@]3(CC1)COC(=O)/C=C(/CCO[C@H](/C=C/C=C\C(=O)O[C@H]4[C@]3(C(=C)[C@@H](C4)O2)C)[C@@H](C)O)\C
|
|
InChI |
InChI=1S/C29H38O7/c1-18-10-12-29-17-34-27(32)15-19(2)11-13-33-22(21(4)30)8-6-7-9-26(31)36-24-16-23(35-25(29)14-18)20(3)28(24,29)5/h6-9,14-15,21-25,30H,3,10-13,16-17H2,1-2,4-5H3/b8-6+,9-7-,19-15+/t21-,22-,23-,24-,25-,28-,29-/m1/s1
|
|
InChIKey |
QRZOAFBSHUOELI-YLAZPCKSSA-N
|
|
Synonyms |
12,13-deoxyroridin E; CHEMBL475690; (1R,3R,8R,12E,17R,18E,20Z,24R,25S)-17-[(1R)-1-hydroxyethyl]-5,13,25-trimethyl-26-methylidene-2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,12,18,20-tetraene-11,22-dione
|
|
CAS | NA | |
PubChem CID | 10625150 | |
ChEMBL ID | CHEMBL475690 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 498.6 | ALogp: | 3.1 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 91.3 | Aromatic Rings: | 4 |
Heavy Atoms: | 36 | QED Weighted: | 0.413 |
Caco-2 Permeability: | -5.181 | MDCK Permeability: | 0.00001300 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.665 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.057 |
30% Bioavailability (F30%): | 0.117 |
Blood-Brain-Barrier Penetration (BBB): | 0.056 | Plasma Protein Binding (PPB): | 84.83% |
Volume Distribution (VD): | 2.233 | Fu: | 7.73% |
CYP1A2-inhibitor: | 0.046 | CYP1A2-substrate: | 0.092 |
CYP2C19-inhibitor: | 0.431 | CYP2C19-substrate: | 0.373 |
CYP2C9-inhibitor: | 0.697 | CYP2C9-substrate: | 0.067 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.076 |
CYP3A4-inhibitor: | 0.722 | CYP3A4-substrate: | 0.452 |
Clearance (CL): | 2.097 | Half-life (T1/2): | 0.448 |
hERG Blockers: | 0.569 | Human Hepatotoxicity (H-HT): | 0.932 |
Drug-inuced Liver Injury (DILI): | 0.46 | AMES Toxicity: | 0.947 |
Rat Oral Acute Toxicity: | 0.603 | Maximum Recommended Daily Dose: | 0.973 |
Skin Sensitization: | 0.898 | Carcinogencity: | 0.072 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.911 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003126 | ![]() |
0.750 | D0D2VS | ![]() |
0.229 | ||
ENC004775 | ![]() |
0.648 | D0C7JF | ![]() |
0.227 | ||
ENC003943 | ![]() |
0.638 | D0V4WD | ![]() |
0.219 | ||
ENC003310 | ![]() |
0.611 | D04GJN | ![]() |
0.217 | ||
ENC002240 | ![]() |
0.571 | D04ATM | ![]() |
0.216 | ||
ENC003173 | ![]() |
0.565 | D0F1UL | ![]() |
0.215 | ||
ENC004774 | ![]() |
0.460 | D09WYX | ![]() |
0.213 | ||
ENC002696 | ![]() |
0.446 | D06IIB | ![]() |
0.211 | ||
ENC004446 | ![]() |
0.431 | D0V2JK | ![]() |
0.208 | ||
ENC002026 | ![]() |
0.412 | D0K7HU | ![]() |
0.208 |