NPs Basic Information
|
Name |
(-)-1-Hydroxyboivinianic acid
|
| Molecular Formula | C12H12O5 | |
| IUPAC Name* |
3-hydroxy-4-[(2S)-2-methyl-5-oxooxolan-2-yl]benzoic acid
|
|
| SMILES |
C[C@]1(CCC(=O)O1)C2=C(C=C(C=C2)C(=O)O)O
|
|
| InChI |
InChI=1S/C12H12O5/c1-12(5-4-10(14)17-12)8-3-2-7(11(15)16)6-9(8)13/h2-3,6,13H,4-5H2,1H3,(H,15,16)/t12-/m0/s1
|
|
| InChIKey |
QBZZGMOAQWNCHR-LBPRGKRZSA-N
|
|
| Synonyms |
(-)-1-hydroxyboivinianic acid
|
|
| CAS | NA | |
| PubChem CID | 146684273 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 236.22 | ALogp: | 1.1 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 83.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 17 | QED Weighted: | 0.769 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -5.338 | MDCK Permeability: | 0.00001130 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.013 |
| 30% Bioavailability (F30%): | 0.817 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.251 | Plasma Protein Binding (PPB): | 39.42% |
| Volume Distribution (VD): | 0.252 | Fu: | 60.40% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.016 | CYP1A2-substrate: | 0.47 |
| CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.052 |
| CYP2C9-inhibitor: | 0.02 | CYP2C9-substrate: | 0.13 |
| CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.125 |
| CYP3A4-inhibitor: | 0.098 | CYP3A4-substrate: | 0.129 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 9.957 | Half-life (T1/2): | 0.902 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.115 |
| Drug-inuced Liver Injury (DILI): | 0.825 | AMES Toxicity: | 0.013 |
| Rat Oral Acute Toxicity: | 0.024 | Maximum Recommended Daily Dose: | 0.024 |
| Skin Sensitization: | 0.148 | Carcinogencity: | 0.075 |
| Eye Corrosion: | 0.018 | Eye Irritation: | 0.407 |
| Respiratory Toxicity: | 0.118 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003405 |  |
1.000 | D01WJL |  |
0.316 | ||
| ENC004186 |  |
1.000 | D0C4YC |  |
0.316 | ||
| ENC002280 |  |
0.565 | D0N0RU |  |
0.289 | ||
| ENC004191 |  |
0.565 | D0Y7PG |  |
0.282 | ||
| ENC004190 |  |
0.565 | D07HBX |  |
0.281 | ||
| ENC002187 |  |
0.565 | D0BA6T |  |
0.269 | ||
| ENC004193 |  |
0.556 | D0V9EN |  |
0.266 | ||
| ENC004192 |  |
0.556 | D02DPU |  |
0.264 | ||
| ENC003790 |  |
0.500 | D08HVR |  |
0.258 | ||
| ENC000002 |  |
0.442 | D0P7JZ |  |
0.257 | ||