![]() |
Name |
(7R,11S)-7,12-epoxysydonic acid
|
Molecular Formula | C15H20O4 | |
IUPAC Name* |
4-[(2R,6S)-2,6-dimethyloxepan-2-yl]-3-hydroxybenzoic acid
|
|
SMILES |
C[C@H]1CCC[C@](OC1)(C)C2=C(C=C(C=C2)C(=O)O)O
|
|
InChI |
InChI=1S/C15H20O4/c1-10-4-3-7-15(2,19-9-10)12-6-5-11(14(17)18)8-13(12)16/h5-6,8,10,16H,3-4,7,9H2,1-2H3,(H,17,18)/t10-,15+/m0/s1
|
|
InChIKey |
ZOBROXLCZDPOMC-ZUZCIYMTSA-N
|
|
Synonyms |
(7R,11S)-7,12-epoxysydonic acid
|
|
CAS | NA | |
PubChem CID | 146684345 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 264.32 | ALogp: | 2.6 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 19 | QED Weighted: | 0.849 |
Caco-2 Permeability: | -4.882 | MDCK Permeability: | 0.00001810 |
Pgp-inhibitor: | 0.009 | Pgp-substrate: | 0.03 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.033 |
Blood-Brain-Barrier Penetration (BBB): | 0.112 | Plasma Protein Binding (PPB): | 87.13% |
Volume Distribution (VD): | 0.274 | Fu: | 15.00% |
CYP1A2-inhibitor: | 0.059 | CYP1A2-substrate: | 0.745 |
CYP2C19-inhibitor: | 0.043 | CYP2C19-substrate: | 0.063 |
CYP2C9-inhibitor: | 0.213 | CYP2C9-substrate: | 0.125 |
CYP2D6-inhibitor: | 0.036 | CYP2D6-substrate: | 0.109 |
CYP3A4-inhibitor: | 0.052 | CYP3A4-substrate: | 0.088 |
Clearance (CL): | 2.411 | Half-life (T1/2): | 0.859 |
hERG Blockers: | 0.08 | Human Hepatotoxicity (H-HT): | 0.36 |
Drug-inuced Liver Injury (DILI): | 0.952 | AMES Toxicity: | 0.019 |
Rat Oral Acute Toxicity: | 0.068 | Maximum Recommended Daily Dose: | 0.028 |
Skin Sensitization: | 0.432 | Carcinogencity: | 0.159 |
Eye Corrosion: | 0.014 | Eye Irritation: | 0.917 |
Respiratory Toxicity: | 0.142 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D0P6VV | ![]() |
0.288 | ||||
![]() |
D0C4YC | ![]() |
0.286 | ||||
![]() |
D01WJL | ![]() |
0.286 | ||||
![]() |
D03XES | ![]() |
0.278 | ||||
![]() |
D0N0RU | ![]() |
0.271 | ||||
![]() |
D0D0GV | ![]() |
0.268 | ||||
![]() |
D0W6DG | ![]() |
0.264 | ||||
![]() |
D0S2JI | ![]() |
0.261 | ||||
![]() |
D01CKY | ![]() |
0.260 | ||||
![]() |
D0T3HY | ![]() |
0.259 |