|
Name |
22-hydroxylshearinine F
|
Molecular Formula | C37H45NO6 | |
IUPAC Name* |
(1S,4R,5S,17R,23S,26S,30R)-17,26-dihydroxy-4,5,13,13,15,15,31,31-octamethyl-14,32,33-trioxa-7-azanonacyclo[28.2.1.01,27.04,26.05,23.06,21.08,20.010,18.011,16]tritriaconta-6(21),8,10(18),11(16),19,27-hexaen-29-one
|
|
SMILES |
C[C@]12CC[C@]34C(=CC(=O)[C@H](O3)C(O4)(C)C)[C@@]1(CC[C@@H]5[C@@]2(C6=C(C5)C7=CC8=C(C=C7N6)C9=C([C@@H]8O)C(OC(C9)(C)C)(C)C)C)O
|
|
InChI |
InChI=1S/C37H45NO6/c1-31(2)17-23-19-15-24-20(14-21(19)28(40)27(23)32(3,4)43-31)22-13-18-9-10-36(41)26-16-25(39)30-33(5,6)44-37(26,42-30)12-11-34(36,7)35(18,8)29(22)38-24/h14-16,18,28,30,38,40-41H,9-13,17H2,1-8H3/t18-,28+,30-,34+,35+,36+,37-/m0/s1
|
|
InChIKey |
VXLPYBLSZWNTJE-AIUUMKESSA-N
|
|
Synonyms |
22-hydroxylshearinine F
|
|
CAS | NA | |
PubChem CID | 139590472 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 599.8 | ALogp: | 2.8 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 101.0 | Aromatic Rings: | 9 |
Heavy Atoms: | 44 | QED Weighted: | 0.337 |
Caco-2 Permeability: | -5.068 | MDCK Permeability: | 0.00001550 |
Pgp-inhibitor: | 0.96 | Pgp-substrate: | 0.034 |
Human Intestinal Absorption (HIA): | 0.03 | 20% Bioavailability (F20%): | 0.925 |
30% Bioavailability (F30%): | 0.223 |
Blood-Brain-Barrier Penetration (BBB): | 0.96 | Plasma Protein Binding (PPB): | 89.22% |
Volume Distribution (VD): | 2.544 | Fu: | 6.92% |
CYP1A2-inhibitor: | 0.025 | CYP1A2-substrate: | 0.988 |
CYP2C19-inhibitor: | 0.317 | CYP2C19-substrate: | 0.811 |
CYP2C9-inhibitor: | 0.459 | CYP2C9-substrate: | 0.045 |
CYP2D6-inhibitor: | 0.025 | CYP2D6-substrate: | 0.111 |
CYP3A4-inhibitor: | 0.831 | CYP3A4-substrate: | 0.939 |
Clearance (CL): | 7.33 | Half-life (T1/2): | 0.04 |
hERG Blockers: | 0.384 | Human Hepatotoxicity (H-HT): | 0.513 |
Drug-inuced Liver Injury (DILI): | 0.466 | AMES Toxicity: | 0.097 |
Rat Oral Acute Toxicity: | 0.982 | Maximum Recommended Daily Dose: | 0.991 |
Skin Sensitization: | 0.769 | Carcinogencity: | 0.971 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.99 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002359 | 0.818 | D0U3SY | 0.217 | ||||
ENC001967 | 0.589 | D06IIB | 0.213 | ||||
ENC001923 | 0.545 | D02JNM | 0.208 | ||||
ENC005557 | 0.429 | D0V6OA | 0.208 | ||||
ENC003876 | 0.379 | D0L2LS | 0.208 | ||||
ENC002168 | 0.377 | D04GJN | 0.204 | ||||
ENC000836 | 0.373 | D0W2EK | 0.201 | ||||
ENC001492 | 0.354 | D0H2MO | 0.200 | ||||
ENC003787 | 0.353 | D0Y2YP | 0.199 | ||||
ENC003329 | 0.341 | D0Q6NZ | 0.199 |