![]() |
Name |
Periconiasin F
|
Molecular Formula | C22H33NO3 | |
IUPAC Name* |
(1S,2S,4S,6R,9S,12S,13R,14S)-2,4-dihydroxy-11,12-dimethyl-7-methylidene-14-(2-methylpropyl)-15-azatetracyclo[7.7.0.01,13.02,6]hexadec-10-en-16-one
|
|
SMILES |
C[C@H]1[C@H]2[C@@H](NC(=O)[C@@]23[C@@H](CC(=C)[C@@H]4[C@]3(C[C@H](C4)O)O)C=C1C)CC(C)C
|
|
InChI |
InChI=1S/C22H33NO3/c1-11(2)6-18-19-14(5)12(3)7-15-8-13(4)17-9-16(24)10-21(17,26)22(15,19)20(25)23-18/h7,11,14-19,24,26H,4,6,8-10H2,1-3,5H3,(H,23,25)/t14-,15-,16+,17-,18+,19+,21+,22-/m1/s1
|
|
InChIKey |
IVNMYYQUDTZHEP-WAEZUTTDSA-N
|
|
Synonyms |
Periconiasin F
|
|
CAS | NA | |
PubChem CID | 139588749 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 359.5 | ALogp: | 1.9 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 69.6 | Aromatic Rings: | 4 |
Heavy Atoms: | 26 | QED Weighted: | 0.66 |
Caco-2 Permeability: | -5.398 | MDCK Permeability: | 0.00005190 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.999 |
Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.935 |
30% Bioavailability (F30%): | 0.294 |
Blood-Brain-Barrier Penetration (BBB): | 0.885 | Plasma Protein Binding (PPB): | 61.29% |
Volume Distribution (VD): | 1.195 | Fu: | 26.54% |
CYP1A2-inhibitor: | 0.037 | CYP1A2-substrate: | 0.194 |
CYP2C19-inhibitor: | 0.084 | CYP2C19-substrate: | 0.696 |
CYP2C9-inhibitor: | 0.06 | CYP2C9-substrate: | 0.036 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.09 |
CYP3A4-inhibitor: | 0.614 | CYP3A4-substrate: | 0.273 |
Clearance (CL): | 14.139 | Half-life (T1/2): | 0.079 |
hERG Blockers: | 0.036 | Human Hepatotoxicity (H-HT): | 0.467 |
Drug-inuced Liver Injury (DILI): | 0.068 | AMES Toxicity: | 0.062 |
Rat Oral Acute Toxicity: | 0.934 | Maximum Recommended Daily Dose: | 0.944 |
Skin Sensitization: | 0.236 | Carcinogencity: | 0.905 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.017 |
Respiratory Toxicity: | 0.979 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003433 | ![]() |
0.707 | D0F1EX | ![]() |
0.250 | ||
ENC003434 | ![]() |
0.602 | D0E9KA | ![]() |
0.246 | ||
ENC005824 | ![]() |
0.448 | D03IKT | ![]() |
0.239 | ||
ENC005825 | ![]() |
0.443 | D0W2EK | ![]() |
0.233 | ||
ENC002049 | ![]() |
0.426 | D08PIQ | ![]() |
0.233 | ||
ENC004242 | ![]() |
0.423 | D04SFH | ![]() |
0.232 | ||
ENC003740 | ![]() |
0.417 | D06WTZ | ![]() |
0.230 | ||
ENC005136 | ![]() |
0.411 | D08SVH | ![]() |
0.226 | ||
ENC002636 | ![]() |
0.410 | D0D2TN | ![]() |
0.222 | ||
ENC004462 | ![]() |
0.410 | D0C8HR | ![]() |
0.221 |