![]() |
Name |
Aspochalasin R
|
Molecular Formula | C25H37NO5 | |
IUPAC Name* |
(1S,9Z,11S,14S,15R,16S)-6-hydroxy-4-methoxy-9,13,14-trimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,5,18-trione
|
|
SMILES |
C[C@H]1[C@H]2[C@@H](NC(=O)[C@@]23[C@@H](/C=C(\CCC(C(=O)C(CC3=O)OC)O)/C)C=C1C)CC(C)C
|
|
InChI |
InChI=1S/C25H37NO5/c1-13(2)9-18-22-16(5)15(4)11-17-10-14(3)7-8-19(27)23(29)20(31-6)12-21(28)25(17,22)24(30)26-18/h10-11,13,16-20,22,27H,7-9,12H2,1-6H3,(H,26,30)/b14-10-/t16-,17+,18+,19?,20?,22+,25-/m1/s1
|
|
InChIKey |
GKNWQNLEUNDXAP-FOZWZDRDSA-N
|
|
Synonyms |
Aspochalasin R
|
|
CAS | NA | |
PubChem CID | 139587383 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 431.6 | ALogp: | 2.5 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 92.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 31 | QED Weighted: | 0.524 |
Caco-2 Permeability: | -4.729 | MDCK Permeability: | 0.00004450 |
Pgp-inhibitor: | 0.996 | Pgp-substrate: | 0.225 |
Human Intestinal Absorption (HIA): | 0.023 | 20% Bioavailability (F20%): | 0.243 |
30% Bioavailability (F30%): | 0.928 |
Blood-Brain-Barrier Penetration (BBB): | 0.97 | Plasma Protein Binding (PPB): | 84.04% |
Volume Distribution (VD): | 0.57 | Fu: | 8.97% |
CYP1A2-inhibitor: | 0.018 | CYP1A2-substrate: | 0.208 |
CYP2C19-inhibitor: | 0.194 | CYP2C19-substrate: | 0.862 |
CYP2C9-inhibitor: | 0.085 | CYP2C9-substrate: | 0.05 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.102 |
CYP3A4-inhibitor: | 0.754 | CYP3A4-substrate: | 0.396 |
Clearance (CL): | 13.043 | Half-life (T1/2): | 0.132 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.665 |
Drug-inuced Liver Injury (DILI): | 0.224 | AMES Toxicity: | 0.244 |
Rat Oral Acute Toxicity: | 0.631 | Maximum Recommended Daily Dose: | 0.534 |
Skin Sensitization: | 0.342 | Carcinogencity: | 0.802 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.97 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002636 | ![]() |
0.750 | D09PJX | ![]() |
0.246 | ||
ENC004462 | ![]() |
0.731 | D0W2EK | ![]() |
0.238 | ||
ENC001855 | ![]() |
0.695 | D0E9KA | ![]() |
0.231 | ||
ENC004242 | ![]() |
0.626 | D03LJR | ![]() |
0.226 | ||
ENC005810 | ![]() |
0.624 | D06YFA | ![]() |
0.224 | ||
ENC005825 | ![]() |
0.612 | D05AFC | ![]() |
0.223 | ||
ENC005136 | ![]() |
0.608 | D07DIM | ![]() |
0.222 | ||
ENC002049 | ![]() |
0.491 | D0D2TN | ![]() |
0.219 | ||
ENC003433 | ![]() |
0.471 | D0K3QS | ![]() |
0.217 | ||
ENC005824 | ![]() |
0.460 | D06WTZ | ![]() |
0.216 |