![]() |
Name |
Peyronellin B
|
Molecular Formula | C28H38O6 | |
IUPAC Name* |
3-[[(1R,2S,5R,6S)-6-[[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-2,5-dihydroxy-7-oxabicyclo[4.1.0]hept-3-en-3-yl]methyl]-4-hydroxy-6-methylpyran-2-one
|
|
SMILES |
CC1=CC[C@@H]2[C@@]([C@H]1C[C@]34[C@@H](C=C([C@@H]([C@H]3O4)O)CC5=C(C=C(OC5=O)C)O)O)(CCCC2(C)C)C
|
|
InChI |
InChI=1S/C28H38O6/c1-15-7-8-21-26(3,4)9-6-10-27(21,5)19(15)14-28-22(30)13-17(23(31)24(28)34-28)12-18-20(29)11-16(2)33-25(18)32/h7,11,13,19,21-24,29-31H,6,8-10,12,14H2,1-5H3/t19-,21-,22+,23-,24+,27+,28-/m0/s1
|
|
InChIKey |
KMTGZPFWHXUAFC-PVVZZRODSA-N
|
|
Synonyms |
Peyronellin B
|
|
CAS | NA | |
PubChem CID | 139588567 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 470.6 | ALogp: | 3.5 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 99.5 | Aromatic Rings: | 5 |
Heavy Atoms: | 34 | QED Weighted: | 0.433 |
Caco-2 Permeability: | -4.827 | MDCK Permeability: | 0.00001090 |
Pgp-inhibitor: | 0.127 | Pgp-substrate: | 0.997 |
Human Intestinal Absorption (HIA): | 0.035 | 20% Bioavailability (F20%): | 0.988 |
30% Bioavailability (F30%): | 0.989 |
Blood-Brain-Barrier Penetration (BBB): | 0.046 | Plasma Protein Binding (PPB): | 89.46% |
Volume Distribution (VD): | 1.875 | Fu: | 7.47% |
CYP1A2-inhibitor: | 0.039 | CYP1A2-substrate: | 0.511 |
CYP2C19-inhibitor: | 0.089 | CYP2C19-substrate: | 0.597 |
CYP2C9-inhibitor: | 0.543 | CYP2C9-substrate: | 0.873 |
CYP2D6-inhibitor: | 0.05 | CYP2D6-substrate: | 0.82 |
CYP3A4-inhibitor: | 0.424 | CYP3A4-substrate: | 0.221 |
Clearance (CL): | 7.101 | Half-life (T1/2): | 0.119 |
hERG Blockers: | 0.049 | Human Hepatotoxicity (H-HT): | 0.725 |
Drug-inuced Liver Injury (DILI): | 0.245 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.907 | Maximum Recommended Daily Dose: | 0.771 |
Skin Sensitization: | 0.179 | Carcinogencity: | 0.226 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.015 |
Respiratory Toxicity: | 0.98 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003420 | ![]() |
0.658 | D0S0NK | ![]() |
0.272 | ||
ENC005585 | ![]() |
0.562 | D04VIS | ![]() |
0.248 | ||
ENC003421 | ![]() |
0.527 | D02JNM | ![]() |
0.232 | ||
ENC003295 | ![]() |
0.333 | D0W2EK | ![]() |
0.230 | ||
ENC005922 | ![]() |
0.330 | D0E9KA | ![]() |
0.224 | ||
ENC003214 | ![]() |
0.325 | D0Y2YP | ![]() |
0.221 | ||
ENC001075 | ![]() |
0.321 | D0D2TN | ![]() |
0.221 | ||
ENC003350 | ![]() |
0.300 | D08PIQ | ![]() |
0.221 | ||
ENC003422 | ![]() |
0.299 | D02QJH | ![]() |
0.218 | ||
ENC004109 | ![]() |
0.299 | D04QNO | ![]() |
0.218 |