![]() |
Name |
Drimenin
|
Molecular Formula | C15H22O2 | |
IUPAC Name* |
(5aS,9aS,9bR)-6,6,9a-trimethyl-5,5a,7,8,9,9b-hexahydro-3H-benzo[g][2]benzofuran-1-one
|
|
SMILES |
C[C@]12CCCC([C@@H]1CC=C3[C@@H]2C(=O)OC3)(C)C
|
|
InChI |
InChI=1S/C15H22O2/c1-14(2)7-4-8-15(3)11(14)6-5-10-9-17-13(16)12(10)15/h5,11-12H,4,6-9H2,1-3H3/t11-,12+,15-/m0/s1
|
|
InChIKey |
BQNSBENKJCLJGN-ZOWXZIJZSA-N
|
|
Synonyms |
Drimenin; 2326-89-8; Drimenin [MI]; (-)-Drimenin; CHEBI:4715; Z8JC838JKO; (5aS,9aS,9bR)-6,6,9a-trimethyl-5,5a,7,8,9,9b-hexahydro-3H-benzo[g][2]benzofuran-1-one; Naphtho(1,2-C)furan-1(3H)-one, 5,5a,6,7,8,9,9a,9b-octahydro-6,6,9a-trimethyl-, (5aS,9aS,9bR)-; Naphtho[1,2-c]furan-1(3H)-one, 5,5a,6,7,8,9,9a,9b-octahydro-6,6,9a-trimethyl-, (5aS,9aS,9bR)-; C09399; CHEMBL457165; UNII-Z8JC838JKO; SCHEMBL7620450; DTXSID50331770; BDBM50465350; Q27106445
|
|
CAS | 2326-89-8 | |
PubChem CID | 442202 | |
ChEMBL ID | CHEMBL457165 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 234.33 | ALogp: | 3.6 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 3 |
Heavy Atoms: | 17 | QED Weighted: | 0.466 |
Caco-2 Permeability: | -4.667 | MDCK Permeability: | 0.00002390 |
Pgp-inhibitor: | 0.109 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.019 |
30% Bioavailability (F30%): | 0.686 |
Blood-Brain-Barrier Penetration (BBB): | 0.142 | Plasma Protein Binding (PPB): | 94.63% |
Volume Distribution (VD): | 2.317 | Fu: | 4.94% |
CYP1A2-inhibitor: | 0.204 | CYP1A2-substrate: | 0.523 |
CYP2C19-inhibitor: | 0.115 | CYP2C19-substrate: | 0.625 |
CYP2C9-inhibitor: | 0.341 | CYP2C9-substrate: | 0.808 |
CYP2D6-inhibitor: | 0.132 | CYP2D6-substrate: | 0.842 |
CYP3A4-inhibitor: | 0.055 | CYP3A4-substrate: | 0.225 |
Clearance (CL): | 15.171 | Half-life (T1/2): | 0.232 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.294 |
Drug-inuced Liver Injury (DILI): | 0.034 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.91 | Maximum Recommended Daily Dose: | 0.386 |
Skin Sensitization: | 0.508 | Carcinogencity: | 0.914 |
Eye Corrosion: | 0.038 | Eye Irritation: | 0.45 |
Respiratory Toxicity: | 0.956 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005461 | ![]() |
0.655 | D0G6AB | ![]() |
0.298 | ||
ENC003350 | ![]() |
0.565 | D0U3GL | ![]() |
0.271 | ||
ENC000704 | ![]() |
0.500 | D0H1QY | ![]() |
0.267 | ||
ENC001452 | ![]() |
0.433 | D0K0EK | ![]() |
0.262 | ||
ENC000956 | ![]() |
0.406 | D0Z1XD | ![]() |
0.256 | ||
ENC005585 | ![]() |
0.405 | D0S0NK | ![]() |
0.248 | ||
ENC001193 | ![]() |
0.403 | D0F1UL | ![]() |
0.247 | ||
ENC000926 | ![]() |
0.394 | D0B4RU | ![]() |
0.247 | ||
ENC005256 | ![]() |
0.392 | D07BSQ | ![]() |
0.247 | ||
ENC005462 | ![]() |
0.391 | D06XMU | ![]() |
0.247 |