![]() |
Name |
(3S,6S)-3-[hydroxy-[2-(2-methylbut-3-en-2-yl)-6,7-bis(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]-6-methylpiperazine-2,5-dione
|
Molecular Formula | C29H39N3O3 | |
IUPAC Name* |
(3S,6S)-3-[hydroxy-[2-(2-methylbut-3-en-2-yl)-6,7-bis(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]-6-methylpiperazine-2,5-dione
|
|
SMILES |
C[C@H]1C(=O)N[C@H](C(=O)N1)C(C2=C(NC3=C2C=CC(=C3CC=C(C)C)CC=C(C)C)C(C)(C)C=C)O
|
|
InChI |
InChI=1S/C29H39N3O3/c1-9-29(7,8)26-22(25(33)24-28(35)30-18(6)27(34)32-24)21-15-13-19(12-10-16(2)3)20(23(21)31-26)14-11-17(4)5/h9-11,13,15,18,24-25,31,33H,1,12,14H2,2-8H3,(H,30,35)(H,32,34)/t18-,24-,25?/m0/s1
|
|
InChIKey |
FAJDKWDVIHHSTP-SYZSWVGQSA-N
|
|
Synonyms |
Arestrictin A
|
|
CAS | NA | |
PubChem CID | 139588472 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 477.6 | ALogp: | 6.5 |
HBD: | 4 | HBA: | 3 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 94.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 35 | QED Weighted: | 0.397 |
Caco-2 Permeability: | -5.411 | MDCK Permeability: | 0.00001190 |
Pgp-inhibitor: | 0.997 | Pgp-substrate: | 0.913 |
Human Intestinal Absorption (HIA): | 0.076 | 20% Bioavailability (F20%): | 0.968 |
30% Bioavailability (F30%): | 0.159 |
Blood-Brain-Barrier Penetration (BBB): | 0.749 | Plasma Protein Binding (PPB): | 85.91% |
Volume Distribution (VD): | 2.475 | Fu: | 7.37% |
CYP1A2-inhibitor: | 0.531 | CYP1A2-substrate: | 0.236 |
CYP2C19-inhibitor: | 0.895 | CYP2C19-substrate: | 0.097 |
CYP2C9-inhibitor: | 0.754 | CYP2C9-substrate: | 0.351 |
CYP2D6-inhibitor: | 0.947 | CYP2D6-substrate: | 0.622 |
CYP3A4-inhibitor: | 0.92 | CYP3A4-substrate: | 0.275 |
Clearance (CL): | 2.245 | Half-life (T1/2): | 0.051 |
hERG Blockers: | 0.352 | Human Hepatotoxicity (H-HT): | 0.862 |
Drug-inuced Liver Injury (DILI): | 0.729 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.966 | Maximum Recommended Daily Dose: | 0.843 |
Skin Sensitization: | 0.063 | Carcinogencity: | 0.064 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.978 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000859 | ![]() |
0.646 | D0Q0PR | ![]() |
0.224 | ||
ENC003867 | ![]() |
0.575 | D06BLQ | ![]() |
0.216 | ||
ENC003866 | ![]() |
0.575 | D0O6KE | ![]() |
0.213 | ||
ENC002069 | ![]() |
0.573 | D03VFL | ![]() |
0.194 | ||
ENC004457 | ![]() |
0.563 | D0W7WC | ![]() |
0.194 | ||
ENC002896 | ![]() |
0.562 | D03DJL | ![]() |
0.189 | ||
ENC004439 | ![]() |
0.528 | D01JFT | ![]() |
0.187 | ||
ENC002068 | ![]() |
0.518 | D0L7LC | ![]() |
0.185 | ||
ENC002460 | ![]() |
0.504 | D0AY7K | ![]() |
0.184 | ||
ENC006144 | ![]() |
0.466 | D0Z1WA | ![]() |
0.180 |