![]() |
Name |
Fusaruside
|
Molecular Formula | C43H77NO9 | |
IUPAC Name* |
(E,2R)-2-hydroxy-N-[(2S,3R,4E,8E,10E)-3-hydroxy-9-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadeca-4,8,10-trien-2-yl]octadec-3-enamide
|
|
SMILES |
CCCCCCCCCCCCCC/C=C/[C@H](C(=O)N[C@@H](CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)[C@@H](/C=C/CC/C=C(\C)/C=C/CCCCCCC)O)O
|
|
InChI |
InChI=1S/C43H77NO9/c1-4-6-8-10-12-13-14-15-16-17-18-20-22-26-31-37(47)42(51)44-35(33-52-43-41(50)40(49)39(48)38(32-45)53-43)36(46)30-27-23-25-29-34(3)28-24-21-19-11-9-7-5-2/h24,26-31,35-41,43,45-50H,4-23,25,32-33H2,1-3H3,(H,44,51)/b28-24+,30-27+,31-26+,34-29+/t35-,36+,37+,38+,39+,40-,41+,43+/m0/s1
|
|
InChIKey |
FWPRXLLJDAFCIU-UTQGHPBTSA-N
|
|
Synonyms |
Fusaruside
|
|
CAS | NA | |
PubChem CID | 139587585 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 752.1 | ALogp: | 10.6 |
HBD: | 7 | HBA: | 9 |
Rotatable Bonds: | 32 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 169.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 53 | QED Weighted: | 0.022 |
Caco-2 Permeability: | -5.432 | MDCK Permeability: | 0.00002070 |
Pgp-inhibitor: | 0.025 | Pgp-substrate: | 0.127 |
Human Intestinal Absorption (HIA): | 0.754 | 20% Bioavailability (F20%): | 1 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.013 | Plasma Protein Binding (PPB): | 98.22% |
Volume Distribution (VD): | 1.126 | Fu: | 1.87% |
CYP1A2-inhibitor: | 0.025 | CYP1A2-substrate: | 0.115 |
CYP2C19-inhibitor: | 0.29 | CYP2C19-substrate: | 0.05 |
CYP2C9-inhibitor: | 0.184 | CYP2C9-substrate: | 0.996 |
CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.101 |
CYP3A4-inhibitor: | 0.346 | CYP3A4-substrate: | 0.013 |
Clearance (CL): | 1.926 | Half-life (T1/2): | 0.341 |
hERG Blockers: | 0.406 | Human Hepatotoxicity (H-HT): | 0.172 |
Drug-inuced Liver Injury (DILI): | 0.019 | AMES Toxicity: | 0.151 |
Rat Oral Acute Toxicity: | 0.027 | Maximum Recommended Daily Dose: | 0.045 |
Skin Sensitization: | 0.965 | Carcinogencity: | 0.02 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.023 |
Respiratory Toxicity: | 0.123 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002194 | ![]() |
0.851 | D00STJ | ![]() |
0.399 | ||
ENC005817 | ![]() |
0.851 | D06KDP | ![]() |
0.350 | ||
ENC002909 | ![]() |
0.851 | D00AOJ | ![]() |
0.333 | ||
ENC005011 | ![]() |
0.644 | D0O1PH | ![]() |
0.327 | ||
ENC003604 | ![]() |
0.644 | D0Z1QC | ![]() |
0.318 | ||
ENC005852 | ![]() |
0.491 | D01NTX | ![]() |
0.315 | ||
ENC002672 | ![]() |
0.459 | D0T9TJ | ![]() |
0.314 | ||
ENC003072 | ![]() |
0.434 | D07ILQ | ![]() |
0.306 | ||
ENC001674 | ![]() |
0.433 | D00FGR | ![]() |
0.287 | ||
ENC004449 | ![]() |
0.431 | D0O1TC | ![]() |
0.262 |