![]() |
Name |
Microsphaerol
|
Molecular Formula | C23H21Cl3O5 | |
IUPAC Name* |
4-chloro-5-[2-chloro-4-(2-chloro-6-methylphenoxy)-3,5,6-trimethylphenoxy]-3-methoxybenzene-1,2-diol
|
|
SMILES |
CC1=C(C(=CC=C1)Cl)OC2=C(C(=C(C(=C2C)C)OC3=C(C(=C(C(=C3)O)O)OC)Cl)Cl)C
|
|
InChI |
InChI=1S/C23H21Cl3O5/c1-10-7-6-8-14(24)20(10)31-21-11(2)12(3)22(17(25)13(21)4)30-16-9-15(27)19(28)23(29-5)18(16)26/h6-9,27-28H,1-5H3
|
|
InChIKey |
NEHFAEVGPMAOKI-UHFFFAOYSA-N
|
|
Synonyms |
Microsphaerol
|
|
CAS | NA | |
PubChem CID | 139587066 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 483.8 | ALogp: | 7.6 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 68.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 31 | QED Weighted: | 0.348 |
Caco-2 Permeability: | -5.105 | MDCK Permeability: | 0.00001380 |
Pgp-inhibitor: | 0.014 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.365 | 20% Bioavailability (F20%): | 0.01 |
30% Bioavailability (F30%): | 0.565 |
Blood-Brain-Barrier Penetration (BBB): | 0.016 | Plasma Protein Binding (PPB): | 102.59% |
Volume Distribution (VD): | 2.074 | Fu: | 0.70% |
CYP1A2-inhibitor: | 0.257 | CYP1A2-substrate: | 0.941 |
CYP2C19-inhibitor: | 0.808 | CYP2C19-substrate: | 0.289 |
CYP2C9-inhibitor: | 0.842 | CYP2C9-substrate: | 0.925 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.864 |
CYP3A4-inhibitor: | 0.143 | CYP3A4-substrate: | 0.89 |
Clearance (CL): | 8.822 | Half-life (T1/2): | 0.123 |
hERG Blockers: | 0.032 | Human Hepatotoxicity (H-HT): | 0.029 |
Drug-inuced Liver Injury (DILI): | 0.443 | AMES Toxicity: | 0.03 |
Rat Oral Acute Toxicity: | 0.9 | Maximum Recommended Daily Dose: | 0.926 |
Skin Sensitization: | 0.954 | Carcinogencity: | 0.134 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.925 |
Respiratory Toxicity: | 0.682 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004448 | ![]() |
0.388 | D06GCK | ![]() |
0.288 | ||
ENC001571 | ![]() |
0.387 | D02VMJ | ![]() |
0.268 | ||
ENC004226 | ![]() |
0.355 | D0WN0U | ![]() |
0.250 | ||
ENC001415 | ![]() |
0.353 | D00CSQ | ![]() |
0.250 | ||
ENC004141 | ![]() |
0.345 | D0Y7TS | ![]() |
0.244 | ||
ENC005301 | ![]() |
0.336 | D0ZX2G | ![]() |
0.243 | ||
ENC002078 | ![]() |
0.331 | D0H2ZW | ![]() |
0.241 | ||
ENC003695 | ![]() |
0.331 | D0C6DT | ![]() |
0.240 | ||
ENC003472 | ![]() |
0.330 | D01XNB | ![]() |
0.240 | ||
ENC005123 | ![]() |
0.330 | D02LZB | ![]() |
0.234 |