![]() |
Name |
Chlorflavonin
|
Molecular Formula | C18H15ClO7 | |
IUPAC Name* |
2-(3-chloro-2-hydroxyphenyl)-5-hydroxy-3,7,8-trimethoxychromen-4-one
|
|
SMILES |
COC1=C(C2=C(C(=C1)O)C(=O)C(=C(O2)C3=C(C(=CC=C3)Cl)O)OC)OC
|
|
InChI |
InChI=1S/C18H15ClO7/c1-23-11-7-10(20)12-14(22)18(25-3)15(26-17(12)16(11)24-2)8-5-4-6-9(19)13(8)21/h4-7,20-21H,1-3H3
|
|
InChIKey |
JLSQXYITDXJTKL-UHFFFAOYSA-N
|
|
Synonyms |
Chlorflavonin; 23363-64-6; 3'-Chloro-2',5-dihydroxy-3,7,8-trimethoxyflavone; Chloroflavonin; CHEBI:3613; SCHEMBL3803000; Flavone, 3'-chloro-2',5-dihydroxy-3,7,8-trimethoxy-; DTXSID80177921; LMPK12113075; AKOS017096639; 4H-1-Benzopyran-4-one, 2-(3-chloro-2-hydroxyphenyl)-5-hydroxy-3,7,8-trimethoxy-; C10027; EN300-24196048; 3'-chloro-5,2'-dihydroxy-3,7,8-trimethoxyflavone; Q27106149; 2-(3-Chloro-2-hydroxyphenyl)-5-hydroxy-3,7,8-trimethoxy-4H-chromen-4-one; 2-(3-chloro-2-hydroxyphenyl)-5-hydroxy-3,7,8-trimethoxy-4H-1-benzopyran-4-one; 2-(3-Chloro-2-hydroxyphenyl)-5-hydroxy-3,7,8-trimethoxy-4H-chromen-4-one #
|
|
CAS | 23363-64-6 | |
PubChem CID | 5281606 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 378.8 | ALogp: | 3.8 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 94.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 26 | QED Weighted: | 0.699 |
Caco-2 Permeability: | -4.889 | MDCK Permeability: | 0.00002050 |
Pgp-inhibitor: | 0.995 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.005 | Plasma Protein Binding (PPB): | 93.84% |
Volume Distribution (VD): | 0.712 | Fu: | 8.59% |
CYP1A2-inhibitor: | 0.723 | CYP1A2-substrate: | 0.966 |
CYP2C19-inhibitor: | 0.645 | CYP2C19-substrate: | 0.245 |
CYP2C9-inhibitor: | 0.843 | CYP2C9-substrate: | 0.786 |
CYP2D6-inhibitor: | 0.199 | CYP2D6-substrate: | 0.442 |
CYP3A4-inhibitor: | 0.378 | CYP3A4-substrate: | 0.316 |
Clearance (CL): | 3.473 | Half-life (T1/2): | 0.442 |
hERG Blockers: | 0.043 | Human Hepatotoxicity (H-HT): | 0.204 |
Drug-inuced Liver Injury (DILI): | 0.981 | AMES Toxicity: | 0.553 |
Rat Oral Acute Toxicity: | 0.467 | Maximum Recommended Daily Dose: | 0.066 |
Skin Sensitization: | 0.297 | Carcinogencity: | 0.169 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.509 |
Respiratory Toxicity: | 0.207 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005522 | ![]() |
0.772 | D06GCK | ![]() |
0.458 | ||
ENC001772 | ![]() |
0.474 | D0G4KG | ![]() |
0.363 | ||
ENC002201 | ![]() |
0.440 | D02LZB | ![]() |
0.352 | ||
ENC003472 | ![]() |
0.430 | D09DHY | ![]() |
0.336 | ||
ENC003106 | ![]() |
0.430 | D0Y7TS | ![]() |
0.315 | ||
ENC005649 | ![]() |
0.422 | D04TDQ | ![]() |
0.311 | ||
ENC001751 | ![]() |
0.412 | D0K8KX | ![]() |
0.310 | ||
ENC001405 | ![]() |
0.410 | D0QD1G | ![]() |
0.292 | ||
ENC004990 | ![]() |
0.410 | D0D4HN | ![]() |
0.289 | ||
ENC002134 | ![]() |
0.409 | D0V8HJ | ![]() |
0.284 |