![]() |
Name |
Altertoxin IV
|
Molecular Formula | C20H16O6 | |
IUPAC Name* |
(2S,3R,5S,6R,12S,13R,15S,16R)-4,14-dioxaheptacyclo[10.8.1.12,7.03,5.013,15.017,21.011,22]docosa-1(21),7,9,11(22),17,19-hexaene-6,8,16,18-tetrol
|
|
SMILES |
C1=CC(=C2[C@H]([C@H]3[C@H](O3)[C@@H]4C2=C1[C@@H]5[C@@H]6[C@@H](O6)[C@@H](C7=C(C=CC4=C57)O)O)O)O
|
|
InChI |
InChI=1S/C20H16O6/c21-7-3-1-5-9-12(18-20(26-18)15(23)13(7)9)6-2-4-8(22)14-10(6)11(5)17-19(25-17)16(14)24/h1-4,11-12,15-24H/t11-,12-,15+,16+,17+,18+,19-,20-/m0/s1
|
|
InChIKey |
XSDHEAABYNNUIQ-YZRPZTIYSA-N
|
|
Synonyms |
Altertoxin IV
|
|
CAS | NA | |
PubChem CID | 139585641 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 352.3 | ALogp: | 0.1 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 106.0 | Aromatic Rings: | 7 |
Heavy Atoms: | 26 | QED Weighted: | 0.539 |
Caco-2 Permeability: | -5.907 | MDCK Permeability: | 0.00000800 |
Pgp-inhibitor: | 0.009 | Pgp-substrate: | 0.998 |
Human Intestinal Absorption (HIA): | 0.899 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.925 |
Blood-Brain-Barrier Penetration (BBB): | 0.063 | Plasma Protein Binding (PPB): | 95.80% |
Volume Distribution (VD): | 0.775 | Fu: | 5.46% |
CYP1A2-inhibitor: | 0.045 | CYP1A2-substrate: | 0.305 |
CYP2C19-inhibitor: | 0.034 | CYP2C19-substrate: | 0.827 |
CYP2C9-inhibitor: | 0.355 | CYP2C9-substrate: | 0.974 |
CYP2D6-inhibitor: | 0.035 | CYP2D6-substrate: | 0.199 |
CYP3A4-inhibitor: | 0.165 | CYP3A4-substrate: | 0.421 |
Clearance (CL): | 1.23 | Half-life (T1/2): | 0.139 |
hERG Blockers: | 0.06 | Human Hepatotoxicity (H-HT): | 0.907 |
Drug-inuced Liver Injury (DILI): | 0.841 | AMES Toxicity: | 0.616 |
Rat Oral Acute Toxicity: | 0.34 | Maximum Recommended Daily Dose: | 0.946 |
Skin Sensitization: | 0.92 | Carcinogencity: | 0.038 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.764 |
Respiratory Toxicity: | 0.93 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003841 | ![]() |
0.413 | D0AZ8C | ![]() |
0.237 | ||
ENC005474 | ![]() |
0.404 | D0I9HF | ![]() |
0.231 | ||
ENC000987 | ![]() |
0.404 | D04AIT | ![]() |
0.222 | ||
ENC002008 | ![]() |
0.330 | D0U3YB | ![]() |
0.218 | ||
ENC004967 | ![]() |
0.330 | D0K8KX | ![]() |
0.218 | ||
ENC002856 | ![]() |
0.309 | D00KRE | ![]() |
0.218 | ||
ENC002122 | ![]() |
0.286 | D09NIB | ![]() |
0.214 | ||
ENC003961 | ![]() |
0.286 | D0H6QU | ![]() |
0.213 | ||
ENC001532 | ![]() |
0.282 | D08DFX | ![]() |
0.211 | ||
ENC005535 | ![]() |
0.281 | D0R6BI | ![]() |
0.209 |