![]() |
Name |
Cytosporin J
|
Molecular Formula | C19H30O6 | |
IUPAC Name* |
(1aS,2R,4aS,7S,8aR)-3-(5-hydroxyhept-1-enyl)-4-(hydroxymethyl)-6,6-dimethyl-2,4a,7,8-tetrahydro-1aH-oxireno[2,3-e]chromene-2,7-diol
|
|
SMILES |
CCC(CCC=CC1=C([C@H]2[C@]3(C[C@@H](C(O2)(C)C)O)[C@H]([C@@H]1O)O3)CO)O
|
|
InChI |
InChI=1S/C19H30O6/c1-4-11(21)7-5-6-8-12-13(10-20)16-19(17(25-19)15(12)23)9-14(22)18(2,3)24-16/h6,8,11,14-17,20-23H,4-5,7,9-10H2,1-3H3/t11?,14-,15+,16-,17-,19+/m0/s1
|
|
InChIKey |
FOLDSHFACNCHBB-CNQQIICXSA-N
|
|
Synonyms |
Cytosporin J
|
|
CAS | NA | |
PubChem CID | 139583745 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 354.4 | ALogp: | -0.8 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 103.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 25 | QED Weighted: | 0.535 |
Caco-2 Permeability: | -5.047 | MDCK Permeability: | 0.00001240 |
Pgp-inhibitor: | 0.908 | Pgp-substrate: | 0.992 |
Human Intestinal Absorption (HIA): | 0.491 | 20% Bioavailability (F20%): | 0.389 |
30% Bioavailability (F30%): | 0.789 |
Blood-Brain-Barrier Penetration (BBB): | 0.233 | Plasma Protein Binding (PPB): | 21.02% |
Volume Distribution (VD): | 1.372 | Fu: | 53.52% |
CYP1A2-inhibitor: | 0.017 | CYP1A2-substrate: | 0.058 |
CYP2C19-inhibitor: | 0.009 | CYP2C19-substrate: | 0.684 |
CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.038 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.094 |
CYP3A4-inhibitor: | 0.009 | CYP3A4-substrate: | 0.237 |
Clearance (CL): | 6.468 | Half-life (T1/2): | 0.756 |
hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.862 |
Drug-inuced Liver Injury (DILI): | 0.177 | AMES Toxicity: | 0.351 |
Rat Oral Acute Toxicity: | 0.854 | Maximum Recommended Daily Dose: | 0.979 |
Skin Sensitization: | 0.904 | Carcinogencity: | 0.824 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.111 |
Respiratory Toxicity: | 0.977 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002977 | ![]() |
0.813 | D04VIS | ![]() |
0.214 | ||
ENC004329 | ![]() |
0.813 | D04QNO | ![]() |
0.203 | ||
ENC004327 | ![]() |
0.813 | D0Y7IU | ![]() |
0.203 | ||
ENC002511 | ![]() |
0.763 | D0HR8Z | ![]() |
0.200 | ||
ENC004326 | ![]() |
0.763 | D0V0IX | ![]() |
0.200 | ||
ENC003663 | ![]() |
0.596 | D0N3NO | ![]() |
0.193 | ||
ENC004330 | ![]() |
0.578 | D0C6NM | ![]() |
0.192 | ||
ENC004325 | ![]() |
0.570 | D02RQU | ![]() |
0.192 | ||
ENC004324 | ![]() |
0.529 | D03BLF | ![]() |
0.192 | ||
ENC003183 | ![]() |
0.524 | D06FEA | ![]() |
0.191 |