|
Name |
Cytosporin D
|
Molecular Formula | C19H30O5 | |
IUPAC Name* |
(1aS,2R,4aS,7S,8aR)-3-[(E)-hept-1-enyl]-4-(hydroxymethyl)-6,6-dimethyl-2,4a,7,8-tetrahydro-1aH-oxireno[2,3-e]chromene-2,7-diol
|
|
SMILES |
CCCCC/C=C/C1=C([C@H]2[C@]3(C[C@@H](C(O2)(C)C)O)[C@H]([C@@H]1O)O3)CO
|
|
InChI |
InChI=1S/C19H30O5/c1-4-5-6-7-8-9-12-13(11-20)16-19(17(24-19)15(12)22)10-14(21)18(2,3)23-16/h8-9,14-17,20-22H,4-7,10-11H2,1-3H3/b9-8+/t14-,15+,16-,17-,19+/m0/s1
|
|
InChIKey |
BAJVQMTZYHWAMD-UDIPEWIUSA-N
|
|
Synonyms |
Cytosporin D; CHEMBL4442474; CHEBI:70039; Q27138378; (1aS,2R,4aS,7S,8aR)-3-[(E)-hept-1-enyl]-4-(hydroxymethyl)-6,6-dimethyl-2,4a,7,8-tetrahydro-1aH-oxireno[2,3-e]chromene-2,7-diol
|
|
CAS | NA | |
PubChem CID | 24882685 | |
ChEMBL ID | CHEMBL4442474 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 338.4 | ALogp: | 0.7 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 82.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 24 | QED Weighted: | 0.512 |
Caco-2 Permeability: | -4.714 | MDCK Permeability: | 0.00002340 |
Pgp-inhibitor: | 0.914 | Pgp-substrate: | 0.89 |
Human Intestinal Absorption (HIA): | 0.018 | 20% Bioavailability (F20%): | 0.468 |
30% Bioavailability (F30%): | 0.435 |
Blood-Brain-Barrier Penetration (BBB): | 0.319 | Plasma Protein Binding (PPB): | 73.11% |
Volume Distribution (VD): | 1.392 | Fu: | 29.33% |
CYP1A2-inhibitor: | 0.034 | CYP1A2-substrate: | 0.085 |
CYP2C19-inhibitor: | 0.022 | CYP2C19-substrate: | 0.609 |
CYP2C9-inhibitor: | 0.02 | CYP2C9-substrate: | 0.09 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.187 |
CYP3A4-inhibitor: | 0.037 | CYP3A4-substrate: | 0.214 |
Clearance (CL): | 5.833 | Half-life (T1/2): | 0.58 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.806 |
Drug-inuced Liver Injury (DILI): | 0.901 | AMES Toxicity: | 0.426 |
Rat Oral Acute Toxicity: | 0.891 | Maximum Recommended Daily Dose: | 0.97 |
Skin Sensitization: | 0.919 | Carcinogencity: | 0.725 |
Eye Corrosion: | 0.079 | Eye Irritation: | 0.623 |
Respiratory Toxicity: | 0.978 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004326 | 1.000 | D0N3NO | 0.239 | ||||
ENC004327 | 0.787 | D06FEA | 0.239 | ||||
ENC003663 | 0.772 | D09SRR | 0.237 | ||||
ENC003598 | 0.763 | D0V0IX | 0.236 | ||||
ENC004330 | 0.750 | D0HR8Z | 0.233 | ||||
ENC002977 | 0.740 | D0H2YX | 0.231 | ||||
ENC004329 | 0.740 | D07PCI | 0.227 | ||||
ENC004325 | 0.727 | D0P1FO | 0.226 | ||||
ENC004324 | 0.679 | D04RGA | 0.220 | ||||
ENC004331 | 0.671 | D04VIS | 0.218 |