![]() |
Name |
6-Isovaleryl-4-methoxy-pyran-2-one
|
Molecular Formula | C11H14O4 | |
IUPAC Name* |
4-methoxy-6-(3-methylbutanoyl)pyran-2-one
|
|
SMILES |
CC(C)CC(=O)C1=CC(=CC(=O)O1)OC
|
|
InChI |
InChI=1S/C11H14O4/c1-7(2)4-9(12)10-5-8(14-3)6-11(13)15-10/h5-7H,4H2,1-3H3
|
|
InChIKey |
RRGHBDAPLFZCII-UHFFFAOYSA-N
|
|
Synonyms |
6-isovaleryl-4-methoxy-pyran-2-one
|
|
CAS | NA | |
PubChem CID | 134817862 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 210.23 | ALogp: | 1.6 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 52.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.716 |
Caco-2 Permeability: | -4.569 | MDCK Permeability: | 0.00002000 |
Pgp-inhibitor: | 0.492 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.013 |
30% Bioavailability (F30%): | 0.983 |
Blood-Brain-Barrier Penetration (BBB): | 0.686 | Plasma Protein Binding (PPB): | 77.82% |
Volume Distribution (VD): | 0.795 | Fu: | 30.41% |
CYP1A2-inhibitor: | 0.846 | CYP1A2-substrate: | 0.892 |
CYP2C19-inhibitor: | 0.75 | CYP2C19-substrate: | 0.487 |
CYP2C9-inhibitor: | 0.485 | CYP2C9-substrate: | 0.794 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.768 |
CYP3A4-inhibitor: | 0.031 | CYP3A4-substrate: | 0.195 |
Clearance (CL): | 10.505 | Half-life (T1/2): | 0.709 |
hERG Blockers: | 0.077 | Human Hepatotoxicity (H-HT): | 0.134 |
Drug-inuced Liver Injury (DILI): | 0.537 | AMES Toxicity: | 0.053 |
Rat Oral Acute Toxicity: | 0.092 | Maximum Recommended Daily Dose: | 0.068 |
Skin Sensitization: | 0.196 | Carcinogencity: | 0.281 |
Eye Corrosion: | 0.452 | Eye Irritation: | 0.966 |
Respiratory Toxicity: | 0.425 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005908 | ![]() |
0.569 | D0DJ1B | ![]() |
0.279 | ||
ENC002738 | ![]() |
0.563 | D0O6KE | ![]() |
0.261 | ||
ENC002315 | ![]() |
0.563 | D05CKR | ![]() |
0.257 | ||
ENC002754 | ![]() |
0.536 | D02XJY | ![]() |
0.254 | ||
ENC002656 | ![]() |
0.529 | D06REO | ![]() |
0.253 | ||
ENC002737 | ![]() |
0.510 | D09GYT | ![]() |
0.250 | ||
ENC002733 | ![]() |
0.492 | D0AN7B | ![]() |
0.239 | ||
ENC002479 | ![]() |
0.472 | D09PJX | ![]() |
0.238 | ||
ENC002736 | ![]() |
0.463 | D0T1LK | ![]() |
0.237 | ||
ENC005564 | ![]() |
0.421 | D0G5UB | ![]() |
0.235 |