![]() |
Name |
2-Oxo-4-methoxy-2H-pyran 6-propionic acid
|
Molecular Formula | C9H10O5 | |
IUPAC Name* |
3-(4-methoxy-6-oxopyran-2-yl)propanoic acid
|
|
SMILES |
COC1=CC(=O)OC(=C1)CCC(=O)O
|
|
InChI |
InChI=1S/C9H10O5/c1-13-7-4-6(2-3-8(10)11)14-9(12)5-7/h4-5H,2-3H2,1H3,(H,10,11)
|
|
InChIKey |
ANMIXQYGZDPTLJ-UHFFFAOYSA-N
|
|
Synonyms |
CHEMBL2331727; ACon1_001779; BDBM50428357; NCGC00180151-01; 2-Oxo-4-methoxy-2H-pyran 6-propionic acid; 3-(4-methoxy-2-oxo-2H-pyran-6-yl)-propanoic acid; BRD-K96439574-001-01-4
|
|
CAS | NA | |
PubChem CID | 24123426 | |
ChEMBL ID | CHEMBL2331727 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 198.17 | ALogp: | 0.2 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 72.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.782 |
Caco-2 Permeability: | -4.746 | MDCK Permeability: | 0.00030779 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.493 |
Human Intestinal Absorption (HIA): | 0.033 | 20% Bioavailability (F20%): | 0.199 |
30% Bioavailability (F30%): | 0.997 |
Blood-Brain-Barrier Penetration (BBB): | 0.208 | Plasma Protein Binding (PPB): | 71.55% |
Volume Distribution (VD): | 0.25 | Fu: | 27.44% |
CYP1A2-inhibitor: | 0.041 | CYP1A2-substrate: | 0.769 |
CYP2C19-inhibitor: | 0.031 | CYP2C19-substrate: | 0.057 |
CYP2C9-inhibitor: | 0.012 | CYP2C9-substrate: | 0.94 |
CYP2D6-inhibitor: | 0.036 | CYP2D6-substrate: | 0.593 |
CYP3A4-inhibitor: | 0.01 | CYP3A4-substrate: | 0.063 |
Clearance (CL): | 8.532 | Half-life (T1/2): | 0.821 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.335 |
Drug-inuced Liver Injury (DILI): | 0.537 | AMES Toxicity: | 0.018 |
Rat Oral Acute Toxicity: | 0.042 | Maximum Recommended Daily Dose: | 0.347 |
Skin Sensitization: | 0.169 | Carcinogencity: | 0.151 |
Eye Corrosion: | 0.76 | Eye Irritation: | 0.862 |
Respiratory Toxicity: | 0.031 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005908 | ![]() |
0.560 | D05CKR | ![]() |
0.303 | ||
ENC003501 | ![]() |
0.472 | D0DJ1B | ![]() |
0.269 | ||
ENC006022 | ![]() |
0.462 | D0AN7B | ![]() |
0.265 | ||
ENC002656 | ![]() |
0.462 | D02XJY | ![]() |
0.261 | ||
ENC004522 | ![]() |
0.458 | D06AAP | ![]() |
0.257 | ||
ENC006023 | ![]() |
0.436 | D02DPU | ![]() |
0.239 | ||
ENC005564 | ![]() |
0.436 | D0G6VL | ![]() |
0.238 | ||
ENC002315 | ![]() |
0.431 | D0C6OQ | ![]() |
0.234 | ||
ENC002738 | ![]() |
0.431 | D06VNK | ![]() |
0.234 | ||
ENC002754 | ![]() |
0.424 | D0R1RS | ![]() |
0.230 |