![]() |
Name |
Helvolic acid methyl ester
|
Molecular Formula | C34H46O8 | |
IUPAC Name* |
methyl (2Z)-2-[(4S,5S,6S,8S,9S,10R,13R,14S,16S)-6,16-diacetyloxy-4,8,10,14-tetramethyl-3,7-dioxo-5,6,9,11,12,13,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoate
|
|
SMILES |
C[C@H]1[C@@H]2[C@@H](C(=O)[C@]3([C@H]([C@]2(C=CC1=O)C)CC[C@@H]\4[C@@]3(C[C@@H](/C4=C(/CCC=C(C)C)\C(=O)OC)OC(=O)C)C)C)OC(=O)C
|
|
InChI |
InChI=1S/C34H46O8/c1-18(2)11-10-12-22(31(39)40-9)27-23-13-14-26-32(6)16-15-24(37)19(3)28(32)29(42-21(5)36)30(38)34(26,8)33(23,7)17-25(27)41-20(4)35/h11,15-16,19,23,25-26,28-29H,10,12-14,17H2,1-9H3/b27-22-/t19-,23+,25+,26+,28-,29+,32-,33+,34-/m1/s1
|
|
InChIKey |
JHEAWXMXAWIRAB-FTVOIDONSA-N
|
|
Synonyms |
Helvolic acid methyl ester; methyl helvolate; CHEBI:141360; methyl (17Z)-6beta,16beta-diacetoxy-4alpha,8,14-trimethyl-3,7-dioxo-5alpha,8alpha,9beta,13alpha,14beta-18-norcholesta-1,17,24-trien-21-oate; methyl (4alpha,6beta,8alpha,9beta,13alpha,14beta,16beta,17Z)-6,16-bis(acetyloxy)-3,7-dioxo-29-nordammara-1,17(20),24-trien-21-oate
|
|
CAS | NA | |
PubChem CID | 134692100 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 582.7 | ALogp: | 5.5 |
HBD: | 0 | HBA: | 8 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 113.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 42 | QED Weighted: | 0.17 |
Caco-2 Permeability: | -4.835 | MDCK Permeability: | 0.00004820 |
Pgp-inhibitor: | 1 | Pgp-substrate: | 0.685 |
Human Intestinal Absorption (HIA): | 0.045 | 20% Bioavailability (F20%): | 0.973 |
30% Bioavailability (F30%): | 0.912 |
Blood-Brain-Barrier Penetration (BBB): | 0.778 | Plasma Protein Binding (PPB): | 92.10% |
Volume Distribution (VD): | 2.065 | Fu: | 5.40% |
CYP1A2-inhibitor: | 0.028 | CYP1A2-substrate: | 0.121 |
CYP2C19-inhibitor: | 0.261 | CYP2C19-substrate: | 0.667 |
CYP2C9-inhibitor: | 0.178 | CYP2C9-substrate: | 0.017 |
CYP2D6-inhibitor: | 0.029 | CYP2D6-substrate: | 0.013 |
CYP3A4-inhibitor: | 0.884 | CYP3A4-substrate: | 0.77 |
Clearance (CL): | 7.439 | Half-life (T1/2): | 0.065 |
hERG Blockers: | 0.041 | Human Hepatotoxicity (H-HT): | 0.605 |
Drug-inuced Liver Injury (DILI): | 0.394 | AMES Toxicity: | 0.018 |
Rat Oral Acute Toxicity: | 0.947 | Maximum Recommended Daily Dose: | 0.922 |
Skin Sensitization: | 0.207 | Carcinogencity: | 0.535 |
Eye Corrosion: | 0.07 | Eye Irritation: | 0.043 |
Respiratory Toxicity: | 0.979 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001480 | ![]() |
0.889 | D0X7XG | ![]() |
0.416 | ||
ENC005487 | ![]() |
0.882 | D0G7KJ | ![]() |
0.281 | ||
ENC003780 | ![]() |
0.732 | D09IEE | ![]() |
0.261 | ||
ENC005236 | ![]() |
0.715 | D01ZOG | ![]() |
0.259 | ||
ENC005154 | ![]() |
0.715 | D08BDT | ![]() |
0.258 | ||
ENC002467 | ![]() |
0.700 | D0OL7F | ![]() |
0.255 | ||
ENC005155 | ![]() |
0.661 | D0H2MO | ![]() |
0.255 | ||
ENC003848 | ![]() |
0.635 | D0X2LV | ![]() |
0.254 | ||
ENC003846 | ![]() |
0.618 | D09WYX | ![]() |
0.250 | ||
ENC005153 | ![]() |
0.559 | D09SIK | ![]() |
0.247 |