![]() |
Name |
Peniciaculin A
|
Molecular Formula | C29H36O5 | |
IUPAC Name* |
2-[(2S)-2-hydroxy-6-methylheptan-2-yl]-5-[[3-(3-hydroxy-5-methylphenoxy)-5-methylphenoxy]methyl]phenol
|
|
SMILES |
CC1=CC(=CC(=C1)OC2=CC(=CC(=C2)OCC3=CC(=C(C=C3)[C@](C)(CCCC(C)C)O)O)C)O
|
|
InChI |
InChI=1S/C29H36O5/c1-19(2)7-6-10-29(5,32)27-9-8-22(15-28(27)31)18-33-24-12-21(4)14-26(17-24)34-25-13-20(3)11-23(30)16-25/h8-9,11-17,19,30-32H,6-7,10,18H2,1-5H3/t29-/m0/s1
|
|
InChIKey |
XSMRXZCLEOLMSC-LJAQVGFWSA-N
|
|
Synonyms |
Peniciaculin A; CHEMBL3577360; J3.493.740K; 2-[(1S)-1-Hydroxy-1,5-dimethylhexyl]-5-[[3-(3-hydroxy-5-methylphenoxy)-5-methylphenoxy]methyl]phenol
|
|
CAS | NA | |
PubChem CID | 122177657 | |
ChEMBL ID | CHEMBL3577360 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 464.6 | ALogp: | 7.4 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 79.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 34 | QED Weighted: | 0.299 |
Caco-2 Permeability: | -5.346 | MDCK Permeability: | 0.00001310 |
Pgp-inhibitor: | 0.971 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.932 |
30% Bioavailability (F30%): | 0.972 |
Blood-Brain-Barrier Penetration (BBB): | 0.038 | Plasma Protein Binding (PPB): | 100.35% |
Volume Distribution (VD): | 0.613 | Fu: | 0.63% |
CYP1A2-inhibitor: | 0.491 | CYP1A2-substrate: | 0.49 |
CYP2C19-inhibitor: | 0.931 | CYP2C19-substrate: | 0.256 |
CYP2C9-inhibitor: | 0.541 | CYP2C9-substrate: | 0.972 |
CYP2D6-inhibitor: | 0.959 | CYP2D6-substrate: | 0.867 |
CYP3A4-inhibitor: | 0.72 | CYP3A4-substrate: | 0.514 |
Clearance (CL): | 10.985 | Half-life (T1/2): | 0.275 |
hERG Blockers: | 0.512 | Human Hepatotoxicity (H-HT): | 0.132 |
Drug-inuced Liver Injury (DILI): | 0.032 | AMES Toxicity: | 0.022 |
Rat Oral Acute Toxicity: | 0.036 | Maximum Recommended Daily Dose: | 0.96 |
Skin Sensitization: | 0.912 | Carcinogencity: | 0.136 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.749 |
Respiratory Toxicity: | 0.657 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002474 | ![]() |
0.449 | D0J7RK | ![]() |
0.268 | ||
ENC002445 | ![]() |
0.439 | D0U3YB | ![]() |
0.262 | ||
ENC004996 | ![]() |
0.406 | D01SAT | ![]() |
0.260 | ||
ENC005185 | ![]() |
0.400 | D04XEG | ![]() |
0.250 | ||
ENC005290 | ![]() |
0.393 | D07TWN | ![]() |
0.250 | ||
ENC002963 | ![]() |
0.388 | D04UTT | ![]() |
0.246 | ||
ENC002962 | ![]() |
0.386 | D0BZ7W | ![]() |
0.240 | ||
ENC004164 | ![]() |
0.386 | D04AIT | ![]() |
0.236 | ||
ENC002944 | ![]() |
0.385 | D0I8CA | ![]() |
0.236 | ||
ENC002564 | ![]() |
0.385 | D0R0FE | ![]() |
0.233 |