![]() |
Name |
Diorcinol B
|
Molecular Formula | C19H24O5 | |
IUPAC Name* |
(2S)-1-[4-hydroxy-2-(3-hydroxy-5-methylphenoxy)-6-methylphenyl]-3-methylbutane-2,3-diol
|
|
SMILES |
CC1=CC(=CC(=C1)OC2=C(C(=CC(=C2)O)C)C[C@@H](C(C)(C)O)O)O
|
|
InChI |
InChI=1S/C19H24O5/c1-11-5-13(20)8-15(6-11)24-17-9-14(21)7-12(2)16(17)10-18(22)19(3,4)23/h5-9,18,20-23H,10H2,1-4H3/t18-/m0/s1
|
|
InChIKey |
AZIWXFFUSGNPTA-SFHVURJKSA-N
|
|
Synonyms |
Diorcinol B
|
|
CAS | NA | |
PubChem CID | 72696568 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 332.4 | ALogp: | 3.0 |
HBD: | 4 | HBA: | 5 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 90.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 24 | QED Weighted: | 0.665 |
Caco-2 Permeability: | -5.003 | MDCK Permeability: | 0.00001290 |
Pgp-inhibitor: | 0.028 | Pgp-substrate: | 0.924 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.997 |
30% Bioavailability (F30%): | 0.91 |
Blood-Brain-Barrier Penetration (BBB): | 0.043 | Plasma Protein Binding (PPB): | 93.56% |
Volume Distribution (VD): | 0.479 | Fu: | 4.10% |
CYP1A2-inhibitor: | 0.754 | CYP1A2-substrate: | 0.353 |
CYP2C19-inhibitor: | 0.119 | CYP2C19-substrate: | 0.145 |
CYP2C9-inhibitor: | 0.159 | CYP2C9-substrate: | 0.922 |
CYP2D6-inhibitor: | 0.78 | CYP2D6-substrate: | 0.685 |
CYP3A4-inhibitor: | 0.108 | CYP3A4-substrate: | 0.277 |
Clearance (CL): | 13.224 | Half-life (T1/2): | 0.898 |
hERG Blockers: | 0.107 | Human Hepatotoxicity (H-HT): | 0.019 |
Drug-inuced Liver Injury (DILI): | 0.034 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.826 | Maximum Recommended Daily Dose: | 0.977 |
Skin Sensitization: | 0.912 | Carcinogencity: | 0.087 |
Eye Corrosion: | 0.016 | Eye Irritation: | 0.479 |
Respiratory Toxicity: | 0.756 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004164 | ![]() |
1.000 | D0M8RC | ![]() |
0.342 | ||
ENC005185 | ![]() |
0.845 | D04XEG | ![]() |
0.289 | ||
ENC002963 | ![]() |
0.819 | D02UFG | ![]() |
0.284 | ||
ENC003608 | ![]() |
0.744 | D04UTT | ![]() |
0.268 | ||
ENC003317 | ![]() |
0.726 | D07EXH | ![]() |
0.257 | ||
ENC002965 | ![]() |
0.658 | D07MGA | ![]() |
0.250 | ||
ENC002964 | ![]() |
0.653 | D09EBS | ![]() |
0.250 | ||
ENC004163 | ![]() |
0.613 | D04AIT | ![]() |
0.245 | ||
ENC004152 | ![]() |
0.512 | D05VIX | ![]() |
0.244 | ||
ENC005186 | ![]() |
0.512 | D03TPR | ![]() |
0.243 |