![]() |
Name |
Integrasone B
|
Molecular Formula | C16H24O5 | |
IUPAC Name* |
(1aR,2R,5R,6R,6aS)-2,6-dihydroxy-5-octyl-2,5,6,6a-tetrahydro-1aH-oxireno[2,3-f][2]benzofuran-3-one
|
|
SMILES |
CCCCCCCC[C@@H]1C2=C([C@H]([C@@H]3[C@H]([C@@H]2O)O3)O)C(=O)O1
|
|
InChI |
InChI=1S/C16H24O5/c1-2-3-4-5-6-7-8-9-10-11(16(19)20-9)13(18)15-14(21-15)12(10)17/h9,12-15,17-18H,2-8H2,1H3/t9-,12-,13-,14+,15-/m1/s1
|
|
InChIKey |
ADULMGULFKSLSO-LQHIQZRBSA-N
|
|
Synonyms |
Integrasone B
|
|
CAS | NA | |
PubChem CID | 102134878 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 296.36 | ALogp: | 1.6 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 79.3 | Aromatic Rings: | 3 |
Heavy Atoms: | 21 | QED Weighted: | 0.427 |
Caco-2 Permeability: | -5.03 | MDCK Permeability: | 0.00002240 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.218 |
Human Intestinal Absorption (HIA): | 0.127 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.015 |
Blood-Brain-Barrier Penetration (BBB): | 0.757 | Plasma Protein Binding (PPB): | 94.55% |
Volume Distribution (VD): | 2.006 | Fu: | 4.93% |
CYP1A2-inhibitor: | 0.037 | CYP1A2-substrate: | 0.224 |
CYP2C19-inhibitor: | 0.022 | CYP2C19-substrate: | 0.497 |
CYP2C9-inhibitor: | 0.14 | CYP2C9-substrate: | 0.956 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.223 |
CYP3A4-inhibitor: | 0.01 | CYP3A4-substrate: | 0.071 |
Clearance (CL): | 1.477 | Half-life (T1/2): | 0.218 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.306 |
Drug-inuced Liver Injury (DILI): | 0.913 | AMES Toxicity: | 0.116 |
Rat Oral Acute Toxicity: | 0.823 | Maximum Recommended Daily Dose: | 0.023 |
Skin Sensitization: | 0.242 | Carcinogencity: | 0.046 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.882 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004177 | ![]() |
0.570 | D0XN8C | ![]() |
0.326 | ||
ENC004176 | ![]() |
0.544 | D0I4DQ | ![]() |
0.306 | ||
ENC002066 | ![]() |
0.473 | D09ANG | ![]() |
0.279 | ||
ENC004174 | ![]() |
0.464 | D00CTS | ![]() |
0.279 | ||
ENC004175 | ![]() |
0.464 | D09SRR | ![]() |
0.276 | ||
ENC002006 | ![]() |
0.407 | D03ZJE | ![]() |
0.269 | ||
ENC002302 | ![]() |
0.407 | D00HCQ | ![]() |
0.257 | ||
ENC004173 | ![]() |
0.398 | D0H2YX | ![]() |
0.257 | ||
ENC002397 | ![]() |
0.377 | D0V0IX | ![]() |
0.252 | ||
ENC002062 | ![]() |
0.369 | D07UHS | ![]() |
0.247 |