|
Name |
Palmarumycin B4
|
Molecular Formula | C20H20O8 | |
IUPAC Name* |
(1S,2S,3S,4R,6S,7R,10S)-spiro[11-oxatricyclo[4.4.1.01,6]undecane-5,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene]-2,3,4,7,10-pentol
|
|
SMILES |
C1C[C@H]([C@@]23[C@@]([C@H]1O)(O2)[C@H]([C@@H]([C@H](C34OC5=CC=CC6=C5C(=CC=C6)O4)O)O)O)O
|
|
InChI |
InChI=1S/C20H20O8/c21-12-7-8-13(22)19-18(12,28-19)16(24)15(23)17(25)20(19)26-10-5-1-3-9-4-2-6-11(27-20)14(9)10/h1-6,12-13,15-17,21-25H,7-8H2/t12-,13+,15-,16-,17+,18-,19-/m0/s1
|
|
InChIKey |
GJOPRRHPJJXPBD-XJOGIRLRSA-N
|
|
Synonyms |
Palmarumycin B4; CHEMBL3342635
|
|
CAS | NA | |
PubChem CID | 101888372 | |
ChEMBL ID | CHEMBL3342635 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 388.4 | ALogp: | -0.6 |
HBD: | 5 | HBA: | 8 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 132.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 28 | QED Weighted: | 0.395 |
Caco-2 Permeability: | -5.806 | MDCK Permeability: | 0.00002220 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.942 |
Human Intestinal Absorption (HIA): | 0.137 | 20% Bioavailability (F20%): | 0.021 |
30% Bioavailability (F30%): | 0.865 |
Blood-Brain-Barrier Penetration (BBB): | 0.349 | Plasma Protein Binding (PPB): | 93.95% |
Volume Distribution (VD): | 0.453 | Fu: | 3.12% |
CYP1A2-inhibitor: | 0.038 | CYP1A2-substrate: | 0.121 |
CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.324 |
CYP2C9-inhibitor: | 0.006 | CYP2C9-substrate: | 0.262 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.229 |
CYP3A4-inhibitor: | 0.009 | CYP3A4-substrate: | 0.081 |
Clearance (CL): | 7.659 | Half-life (T1/2): | 0.504 |
hERG Blockers: | 0.043 | Human Hepatotoxicity (H-HT): | 0.988 |
Drug-inuced Liver Injury (DILI): | 0.516 | AMES Toxicity: | 0.521 |
Rat Oral Acute Toxicity: | 0.738 | Maximum Recommended Daily Dose: | 0.66 |
Skin Sensitization: | 0.288 | Carcinogencity: | 0.972 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.979 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001988 | 0.784 | D0Q3VE | 0.264 | ||||
ENC003196 | 0.736 | D06ALD | 0.237 | ||||
ENC003195 | 0.717 | D06BQU | 0.229 | ||||
ENC003194 | 0.629 | D01TNW | 0.217 | ||||
ENC002185 | 0.570 | D00JRA | 0.212 | ||||
ENC002330 | 0.559 | D0Z1FX | 0.211 | ||||
ENC003239 | 0.559 | D0O6IZ | 0.210 | ||||
ENC003198 | 0.524 | D03DXN | 0.207 | ||||
ENC003238 | 0.514 | D08DFX | 0.203 | ||||
ENC001999 | 0.495 | D08CCE | 0.198 |