![]() |
Name |
Cladospirone bisepoxide
|
Molecular Formula | C20H14O7 | |
IUPAC Name* |
(1'S,2'S,3'R,5'R,7'R,11'S)-2',11'-dihydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-4,12-dioxatetracyclo[5.4.1.01,7.03,5]dodec-9-ene]-8'-one
|
|
SMILES |
C1=CC2=C3C(=C1)OC4([C@H]5[C@H](O5)[C@@H]([C@@]67[C@@]4(O6)C(=O)C=C[C@@H]7O)O)OC3=CC=C2
|
|
InChI |
InChI=1S/C20H14O7/c21-12-7-8-13(22)19-18(12,27-19)16(23)15-17(24-15)20(19)25-10-5-1-3-9-4-2-6-11(26-20)14(9)10/h1-8,12,15-17,21,23H/t12-,15+,16-,17+,18-,19-/m0/s1
|
|
InChIKey |
AUWGMDYISSBOED-CCNMWVGKSA-N
|
|
Synonyms |
Cladospirone bisepoxide; 152607-03-9; CHEMBL89475; (1'S,2'S,3'R,5'R,7'R,11'S)-2',11'-dihydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-4,12-dioxatetracyclo[5.4.1.01,7.03,5]dodec-9-ene]-8'-one; 155866-40-3; Sch53514; BDBM50218804; HY-113622; CS-0062717
|
|
CAS | NA | |
PubChem CID | 10316810 | |
ChEMBL ID | CHEMBL89475 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 366.3 | ALogp: | 0.4 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 101.0 | Aromatic Rings: | 7 |
Heavy Atoms: | 27 | QED Weighted: | 0.667 |
Caco-2 Permeability: | -5.106 | MDCK Permeability: | 0.00003190 |
Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.989 |
Human Intestinal Absorption (HIA): | 0.032 | 20% Bioavailability (F20%): | 0.632 |
30% Bioavailability (F30%): | 0.98 |
Blood-Brain-Barrier Penetration (BBB): | 0.862 | Plasma Protein Binding (PPB): | 88.50% |
Volume Distribution (VD): | 0.557 | Fu: | 2.64% |
CYP1A2-inhibitor: | 0.621 | CYP1A2-substrate: | 0.939 |
CYP2C19-inhibitor: | 0.082 | CYP2C19-substrate: | 0.734 |
CYP2C9-inhibitor: | 0.101 | CYP2C9-substrate: | 0.028 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.282 |
CYP3A4-inhibitor: | 0.185 | CYP3A4-substrate: | 0.775 |
Clearance (CL): | 11.747 | Half-life (T1/2): | 0.637 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.989 |
Drug-inuced Liver Injury (DILI): | 0.983 | AMES Toxicity: | 0.983 |
Rat Oral Acute Toxicity: | 0.928 | Maximum Recommended Daily Dose: | 0.356 |
Skin Sensitization: | 0.928 | Carcinogencity: | 0.911 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.078 |
Respiratory Toxicity: | 0.899 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003194 | ![]() |
0.784 | D08CCE | ![]() |
0.255 | ||
ENC002330 | ![]() |
0.717 | D06TJJ | ![]() |
0.240 | ||
ENC003239 | ![]() |
0.717 | D0Q3VE | ![]() |
0.218 | ||
ENC002185 | ![]() |
0.714 | D09LDR | ![]() |
0.216 | ||
ENC003238 | ![]() |
0.695 | D00JRA | ![]() |
0.214 | ||
ENC001988 | ![]() |
0.625 | D0AZ8C | ![]() |
0.214 | ||
ENC003196 | ![]() |
0.570 | D04BNP | ![]() |
0.212 | ||
ENC003195 | ![]() |
0.570 | D08FTG | ![]() |
0.210 | ||
ENC003198 | ![]() |
0.500 | D0E0OG | ![]() |
0.202 | ||
ENC003197 | ![]() |
0.495 | D0JY5S | ![]() |
0.202 |