![]() |
Name |
cyclo[D-Cys(1)-D-Cys(1)-D-Val-D-Leu-Ile]
|
Molecular Formula | C23H39N5O5S2 | |
IUPAC Name* |
(1S,4S,7R,10R,13S)-4-[(2S)-butan-2-yl]-7-(2-methylpropyl)-10-propan-2-yl-15,16-dithia-2,5,8,11,19-pentazabicyclo[11.4.2]nonadecane-3,6,9,12,18-pentone
|
|
SMILES |
CC[C@H](C)[C@H]1C(=O)N[C@@H]2CSSC[C@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N1)CC(C)C)C(C)C)NC2=O
|
|
InChI |
InChI=1S/C23H39N5O5S2/c1-7-13(6)18-23(33)26-15-9-34-35-10-16(25-20(15)30)21(31)27-17(12(4)5)22(32)24-14(8-11(2)3)19(29)28-18/h11-18H,7-10H2,1-6H3,(H,24,32)(H,25,30)(H,26,33)(H,27,31)(H,28,29)/t13-,14+,15+,16+,17+,18-/m0/s1
|
|
InChIKey |
RNCGDQLZIATDOU-PZELGXHYSA-N
|
|
Synonyms |
Malformin A1
|
|
CAS | NA | |
PubChem CID | 101632905 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 529.7 | ALogp: | 2.1 |
HBD: | 5 | HBA: | 7 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 196.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 35 | QED Weighted: | 0.334 |
Caco-2 Permeability: | -5.679 | MDCK Permeability: | 0.00000379 |
Pgp-inhibitor: | 0.267 | Pgp-substrate: | 0.994 |
Human Intestinal Absorption (HIA): | 0.709 | 20% Bioavailability (F20%): | 0.084 |
30% Bioavailability (F30%): | 0.081 |
Blood-Brain-Barrier Penetration (BBB): | 0.076 | Plasma Protein Binding (PPB): | 63.37% |
Volume Distribution (VD): | 0.539 | Fu: | 19.30% |
CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.03 |
CYP2C19-inhibitor: | 0.077 | CYP2C19-substrate: | 0.055 |
CYP2C9-inhibitor: | 0.154 | CYP2C9-substrate: | 0.039 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.076 |
CYP3A4-inhibitor: | 0.202 | CYP3A4-substrate: | 0.109 |
Clearance (CL): | 6.912 | Half-life (T1/2): | 0.402 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.181 |
Drug-inuced Liver Injury (DILI): | 0.018 | AMES Toxicity: | 0.039 |
Rat Oral Acute Toxicity: | 0.174 | Maximum Recommended Daily Dose: | 0.135 |
Skin Sensitization: | 0.121 | Carcinogencity: | 0.123 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.239 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005469 | ![]() |
1.000 | D0L7LC | ![]() |
0.422 | ||
ENC003254 | ![]() |
0.519 | D02SBQ | ![]() |
0.375 | ||
ENC002373 | ![]() |
0.455 | D0M3FJ | ![]() |
0.332 | ||
ENC002515 | ![]() |
0.422 | D0D8XY | ![]() |
0.321 | ||
ENC002514 | ![]() |
0.406 | D07FEC | ![]() |
0.288 | ||
ENC004731 | ![]() |
0.405 | D08FJL | ![]() |
0.283 | ||
ENC003271 | ![]() |
0.396 | D0J7XL | ![]() |
0.280 | ||
ENC001136 | ![]() |
0.340 | D0M2YE | ![]() |
0.266 | ||
ENC000990 | ![]() |
0.333 | D0K7NQ | ![]() |
0.264 | ||
ENC005563 | ![]() |
0.330 | D02XIY | ![]() |
0.258 |