![]() |
Name |
11-acetoxyisoaustinone
|
Molecular Formula | C27H32O8 | |
IUPAC Name* |
(11-hydroxy-2,2',2',6,9,12-hexamethyl-15-methylidene-6',10,14-trioxospiro[13-oxatetracyclo[7.5.1.01,11.02,7]pentadec-6-ene-5,3'-pyran]-8-yl)acetate
|
|
SMILES |
C=C1C2(C)C(=O)C3(O)C(C)OC(=O)C13C1(C)CCC3(C=CC(=O)OC3(C)C)C(C)=C1C2OC(C)=O
|
|
InChI |
InChI=1S/C27H32O8/c1-13-18-19(34-16(4)28)24(8)14(2)26(21(31)33-15(3)27(26,32)20(24)30)23(18,7)11-12-25(13)10-9-17(29)35-22(25,5)6/h9-10,15,19,32H,2,11-12H2,1,3-8H3/t15-,19+,23+,24+,25+,26+,27-/m1/s1
|
|
InChIKey |
DBPLAZICOMCSTQ-ZYARQYSDSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 484.55 | ALogp: | 2.7 |
HBD: | 1 | HBA: | 8 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 116.2 | Aromatic Rings: | 5 |
Heavy Atoms: | 35 | QED Weighted: | 0.341 |
Caco-2 Permeability: | -5.269 | MDCK Permeability: | 0.00002730 |
Pgp-inhibitor: | 0.965 | Pgp-substrate: | 0.017 |
Human Intestinal Absorption (HIA): | 0.334 | 20% Bioavailability (F20%): | 0.984 |
30% Bioavailability (F30%): | 0.224 |
Blood-Brain-Barrier Penetration (BBB): | 0.784 | Plasma Protein Binding (PPB): | 78.97% |
Volume Distribution (VD): | 1.823 | Fu: | 24.39% |
CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.967 |
CYP2C19-inhibitor: | 0.097 | CYP2C19-substrate: | 0.854 |
CYP2C9-inhibitor: | 0.069 | CYP2C9-substrate: | 0.04 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.021 |
CYP3A4-inhibitor: | 0.757 | CYP3A4-substrate: | 0.942 |
Clearance (CL): | 2.627 | Half-life (T1/2): | 0.008 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.376 |
Drug-inuced Liver Injury (DILI): | 0.92 | AMES Toxicity: | 0.871 |
Rat Oral Acute Toxicity: | 0.54 | Maximum Recommended Daily Dose: | 0.243 |
Skin Sensitization: | 0.009 | Carcinogencity: | 0.951 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.441 |
Respiratory Toxicity: | 0.916 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005318 | ![]() |
1.000 | D0H2MO | ![]() |
0.247 | ||
ENC002577 | ![]() |
0.833 | D03ZZK | ![]() |
0.240 | ||
ENC005189 | ![]() |
0.689 | D0K7LU | ![]() |
0.237 | ||
ENC005317 | ![]() |
0.689 | D0E9KA | ![]() |
0.225 | ||
ENC002987 | ![]() |
0.689 | D09WYX | ![]() |
0.224 | ||
ENC003309 | ![]() |
0.554 | D0P0HT | ![]() |
0.224 | ||
ENC005315 | ![]() |
0.508 | D0X4RS | ![]() |
0.221 | ||
ENC002849 | ![]() |
0.488 | D04GJN | ![]() |
0.221 | ||
ENC003179 | ![]() |
0.478 | D0N0RU | ![]() |
0.218 | ||
ENC003159 | ![]() |
0.478 | D0G7KJ | ![]() |
0.217 |