![]() |
Name |
(3S,3'S)-4-Methyl-3'-phenylspiro[1H-1,4-benzodiazepine-3,2'-oxirane]-2,5-dione
|
Molecular Formula | C17H14N2O3 | |
IUPAC Name* |
(3S,3'S)-4-methyl-3'-phenylspiro[1H-1,4-benzodiazepine-3,2'-oxirane]-2,5-dione
|
|
SMILES |
CN1C(=O)C2=CC=CC=C2NC(=O)[C@@]13[C@@H](O3)C4=CC=CC=C4
|
|
InChI |
InChI=1S/C17H14N2O3/c1-19-15(20)12-9-5-6-10-13(12)18-16(21)17(19)14(22-17)11-7-3-2-4-8-11/h2-10,14H,1H3,(H,18,21)/t14-,17-/m0/s1
|
|
InChIKey |
APLKWZASYUZSBL-YOEHRIQHSA-N
|
|
Synonyms |
Cyclopenin; 19553-26-5; (3S,3'S)-4-Methyl-3'-phenylspiro[1H-1,4-benzodiazepine-3,2'-oxirane]-2,5-dione; (+/-)-Cyclopenin; ZINC4995793; HY-113626A; CS-0255406
|
|
CAS | NA | |
PubChem CID | 92246598 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 294.3 | ALogp: | 1.5 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 61.9 | Aromatic Rings: | 4 |
Heavy Atoms: | 22 | QED Weighted: | 0.823 |
Caco-2 Permeability: | -4.657 | MDCK Permeability: | 0.00003560 |
Pgp-inhibitor: | 0.539 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.014 |
Blood-Brain-Barrier Penetration (BBB): | 0.928 | Plasma Protein Binding (PPB): | 80.16% |
Volume Distribution (VD): | 0.895 | Fu: | 13.52% |
CYP1A2-inhibitor: | 0.429 | CYP1A2-substrate: | 0.728 |
CYP2C19-inhibitor: | 0.595 | CYP2C19-substrate: | 0.873 |
CYP2C9-inhibitor: | 0.523 | CYP2C9-substrate: | 0.208 |
CYP2D6-inhibitor: | 0.025 | CYP2D6-substrate: | 0.804 |
CYP3A4-inhibitor: | 0.185 | CYP3A4-substrate: | 0.912 |
Clearance (CL): | 3.244 | Half-life (T1/2): | 0.226 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.125 |
Drug-inuced Liver Injury (DILI): | 0.977 | AMES Toxicity: | 0.57 |
Rat Oral Acute Toxicity: | 0.494 | Maximum Recommended Daily Dose: | 0.13 |
Skin Sensitization: | 0.86 | Carcinogencity: | 0.901 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.015 |
Respiratory Toxicity: | 0.073 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003111 | ![]() |
0.753 | D08FTG | ![]() |
0.514 | ||
ENC002563 | ![]() |
0.577 | D06UDO | ![]() |
0.435 | ||
ENC004892 | ![]() |
0.557 | D0E4DW | ![]() |
0.422 | ||
ENC004648 | ![]() |
0.494 | D05AFX | ![]() |
0.400 | ||
ENC004650 | ![]() |
0.437 | D0B1FE | ![]() |
0.375 | ||
ENC004649 | ![]() |
0.429 | D0QL3P | ![]() |
0.360 | ||
ENC002863 | ![]() |
0.427 | D06BYV | ![]() |
0.360 | ||
ENC002594 | ![]() |
0.420 | D07VHR | ![]() |
0.358 | ||
ENC003246 | ![]() |
0.393 | D0QV5T | ![]() |
0.352 | ||
ENC003221 | ![]() |
0.393 | D08CCE | ![]() |
0.352 |