|
Name |
Aszonalenin
|
Molecular Formula | C23H23N3O2 | |
IUPAC Name* |
(2R,10S,12R)-10-(2-methylbut-3-en-2-yl)-1,3,14-triazapentacyclo[10.9.0.02,10.04,9.015,20]henicosa-4,6,8,15,17,19-hexaene-13,21-dione
|
|
SMILES |
CC(C)(C=C)[C@]12C[C@@H]3C(=O)NC4=CC=CC=C4C(=O)N3[C@H]1NC5=CC=CC=C25
|
|
InChI |
InChI=1S/C23H23N3O2/c1-4-22(2,3)23-13-18-19(27)24-16-11-7-5-9-14(16)20(28)26(18)21(23)25-17-12-8-6-10-15(17)23/h4-12,18,21,25H,1,13H2,2-3H3,(H,24,27)/t18-,21-,23+/m1/s1
|
|
InChIKey |
AVLMMDWEIUEKEK-AAIMPIBUSA-N
|
|
Synonyms |
ASZONALENIN; Aszonalenine; 81797-27-5; Aszonalenine, (+)-; 0V5DQ674AU; NSC-374337; [5aR,(+)]-14abeta-(1,1-Dimethyl-2-propenyl)-5abeta,13aalpha,14,14a-tetrahydroindolo[3',2'; (5aR,13aR,14aS)-14a-(1,1-Dimethyl-2-propenyl)-5a,13a,14,14a-tetrahydroindolo(3',2':4,5)pyrrolo(2,1-C)(1,4)benzodiazepine-7,13(5H,12H)-dione; Indolo(3',2':4,5)pyrrolo(2,1-C)(1,4)benzodiazepine-7,13(5H,12H)-dione, 14a-(1,1-dimethyl-2-propenyl)-5a,13a,14,14a-tetrahydro-, (5aR,13aR,14aS)-; UNII-0V5DQ674AU; (2R,3S,11R)-aszonalenin; CHEBI:192681; (2R,3S,11R)-aszonalenin zwitterion; HY-123006; CS-0079843; INDOLO(3',2':4,5)PYRROLO(2,1-C)(1,4)BENZODIAZEPINE-7,13(5H,12H)-DIONE, 14A-(1,1-DIMETHYL-2-PROPENYL)-5A,13A,14,14A-TETRAHYDRO-, (5AR-(5A.ALPHA.,13A.BETA.,14A.ALPHA.))-; Indolo(3',2':4,5)pyrrolo(2,1-C)(1,4)benzodiazepine-7,13(5H,12H)-dione, 14a-(1,1-dimethyl-2-propenyl)-5a,13a,14,14a-tetrahydro-, (5ar-(5aalpha,13abeta,14aalpha))-
|
|
CAS | 81797-27-5 | |
PubChem CID | 42636439 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 373.4 | ALogp: | 4.2 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 61.4 | Aromatic Rings: | 5 |
Heavy Atoms: | 28 | QED Weighted: | 0.765 |
Caco-2 Permeability: | -4.918 | MDCK Permeability: | 0.00002800 |
Pgp-inhibitor: | 0.983 | Pgp-substrate: | 0.566 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.15 |
Blood-Brain-Barrier Penetration (BBB): | 0.181 | Plasma Protein Binding (PPB): | 94.66% |
Volume Distribution (VD): | 0.839 | Fu: | 3.88% |
CYP1A2-inhibitor: | 0.106 | CYP1A2-substrate: | 0.248 |
CYP2C19-inhibitor: | 0.95 | CYP2C19-substrate: | 0.704 |
CYP2C9-inhibitor: | 0.876 | CYP2C9-substrate: | 0.772 |
CYP2D6-inhibitor: | 0.462 | CYP2D6-substrate: | 0.213 |
CYP3A4-inhibitor: | 0.935 | CYP3A4-substrate: | 0.643 |
Clearance (CL): | 2.328 | Half-life (T1/2): | 0.109 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.646 |
Drug-inuced Liver Injury (DILI): | 0.804 | AMES Toxicity: | 0.056 |
Rat Oral Acute Toxicity: | 0.88 | Maximum Recommended Daily Dose: | 0.695 |
Skin Sensitization: | 0.642 | Carcinogencity: | 0.2 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.355 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003246 | 0.701 | D08FTG | 0.333 | ||||
ENC003221 | 0.701 | D09LDR | 0.320 | ||||
ENC006112 | 0.588 | D0P3JU | 0.318 | ||||
ENC002563 | 0.448 | D0QL3P | 0.317 | ||||
ENC004892 | 0.433 | D0E4DW | 0.314 | ||||
ENC004648 | 0.427 | D0U7GK | 0.307 | ||||
ENC003110 | 0.420 | D0E0RY | 0.306 | ||||
ENC001985 | 0.412 | D0E0OG | 0.302 | ||||
ENC003111 | 0.385 | D01PZD | 0.300 | ||||
ENC004650 | 0.382 | D08CCE | 0.299 |