|
Name |
(2Z,3E,5E,7E,9E,11E,13E)-2-(2,4-dimethylhexylidene)-14-[4-hydroxy-6-oxo-5-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyran-2-yl]-4-methyltetradeca-3,5,7,9,11,13-hexaenoic acid
|
Molecular Formula | C34H44O10 | |
IUPAC Name* |
(2Z,3E,5E,7E,9E,11E,13E)-2-(2,4-dimethylhexylidene)-14-[4-hydroxy-6-oxo-5-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyran-2-yl]-4-methyltetradeca-3,5,7,9,11,13-hexaenoic acid
|
|
SMILES |
CCC(C)CC(C)/C=C(/C=C(\C)/C=C/C=C/C=C/C=C/C=C/C1=CC(=C(C(=O)O1)[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)O)\C(=O)O
|
|
InChI |
InChI=1S/C34H44O10/c1-5-21(2)16-23(4)18-24(33(40)41)17-22(3)14-12-10-8-6-7-9-11-13-15-25-19-26(36)28(34(42)43-25)32-31(39)30(38)29(37)27(20-35)44-32/h6-15,17-19,21,23,27,29-32,35-39H,5,16,20H2,1-4H3,(H,40,41)/b7-6+,10-8+,11-9+,14-12+,15-13+,22-17+,24-18-/t21?,23?,27-,29+,30+,31-,32+/m1/s1
|
|
InChIKey |
YQULWNMZEPTDEC-KZQZVYFXSA-N
|
|
Synonyms |
CHEMBL2016579; D8646-2-6
|
|
CAS | NA | |
PubChem CID | 56832636 | |
ChEMBL ID | CHEMBL2016579 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 612.7 | ALogp: | 5.2 |
HBD: | 6 | HBA: | 10 |
Rotatable Bonds: | 14 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 174.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 44 | QED Weighted: | 0.127 |
Caco-2 Permeability: | -5.581 | MDCK Permeability: | 0.00000478 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.774 |
Human Intestinal Absorption (HIA): | 0.935 | 20% Bioavailability (F20%): | 0.95 |
30% Bioavailability (F30%): | 0.997 |
Blood-Brain-Barrier Penetration (BBB): | 0.016 | Plasma Protein Binding (PPB): | 88.18% |
Volume Distribution (VD): | 0.737 | Fu: | 3.88% |
CYP1A2-inhibitor: | 0.468 | CYP1A2-substrate: | 0.025 |
CYP2C19-inhibitor: | 0.182 | CYP2C19-substrate: | 0.058 |
CYP2C9-inhibitor: | 0.731 | CYP2C9-substrate: | 0.995 |
CYP2D6-inhibitor: | 0.524 | CYP2D6-substrate: | 0.918 |
CYP3A4-inhibitor: | 0.085 | CYP3A4-substrate: | 0.053 |
Clearance (CL): | 0.543 | Half-life (T1/2): | 0.682 |
hERG Blockers: | 0.211 | Human Hepatotoxicity (H-HT): | 0.884 |
Drug-inuced Liver Injury (DILI): | 0.968 | AMES Toxicity: | 0.031 |
Rat Oral Acute Toxicity: | 0.35 | Maximum Recommended Daily Dose: | 0.94 |
Skin Sensitization: | 0.943 | Carcinogencity: | 0.288 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.835 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002883 | 1.000 | D0FG6M | 0.241 | ||||
ENC004780 | 1.000 | D01TNW | 0.238 | ||||
ENC003441 | 0.382 | D02HYK | 0.227 | ||||
ENC002816 | 0.310 | D02VCJ | 0.223 | ||||
ENC004855 | 0.296 | D0D0SH | 0.219 | ||||
ENC002660 | 0.292 | D05ZYM | 0.214 | ||||
ENC005616 | 0.284 | D03JSJ | 0.213 | ||||
ENC001532 | 0.281 | D0S7DV | 0.212 | ||||
ENC001575 | 0.278 | D08DFX | 0.211 | ||||
ENC003820 | 0.268 | D06ALD | 0.209 |