![]() |
Name |
Xylarenone C, (rel)-
|
Molecular Formula | C26H40O5 | |
IUPAC Name* |
[(1aR,4R,7S,7aR,7bR)-1a-(3-hydroxyprop-1-en-2-yl)-7,7a-dimethyl-2-oxo-5,6,7,7b-tetrahydro-4H-naphtho[1,2-b]oxiren-4-yl] 2,4,6-trimethyloctanoate
|
|
SMILES |
CCC(C)CC(C)CC(C)C(=O)O[C@@H]1CC[C@@H]([C@@]2(C1=CC(=O)[C@]3([C@@H]2O3)C(=C)CO)C)C
|
|
InChI |
InChI=1S/C26H40O5/c1-8-15(2)11-16(3)12-17(4)23(29)30-21-10-9-18(5)25(7)20(21)13-22(28)26(19(6)14-27)24(25)31-26/h13,15-18,21,24,27H,6,8-12,14H2,1-5,7H3/t15?,16?,17?,18-,21+,24+,25+,26-/m0/s1
|
|
InChIKey |
CVLZBOJHINAXHY-VAXWEKKDSA-N
|
|
Synonyms |
Xylarenone C; Xylarenone C, (rel)-; CHEMBL1813183; CHEBI:69732; BDBM50349829; Q27138077
|
|
CAS | NA | |
PubChem CID | 53344593 | |
ChEMBL ID | CHEMBL1813183 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 432.6 | ALogp: | 5.3 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 76.1 | Aromatic Rings: | 3 |
Heavy Atoms: | 31 | QED Weighted: | 0.312 |
Caco-2 Permeability: | -4.834 | MDCK Permeability: | 0.00002460 |
Pgp-inhibitor: | 0.868 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.087 |
30% Bioavailability (F30%): | 0.021 |
Blood-Brain-Barrier Penetration (BBB): | 0.908 | Plasma Protein Binding (PPB): | 56.51% |
Volume Distribution (VD): | 0.939 | Fu: | 52.99% |
CYP1A2-inhibitor: | 0.05 | CYP1A2-substrate: | 0.18 |
CYP2C19-inhibitor: | 0.177 | CYP2C19-substrate: | 0.879 |
CYP2C9-inhibitor: | 0.273 | CYP2C9-substrate: | 0.034 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.042 |
CYP3A4-inhibitor: | 0.878 | CYP3A4-substrate: | 0.779 |
Clearance (CL): | 8.639 | Half-life (T1/2): | 0.888 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.249 |
Drug-inuced Liver Injury (DILI): | 0.63 | AMES Toxicity: | 0.728 |
Rat Oral Acute Toxicity: | 0.134 | Maximum Recommended Daily Dose: | 0.772 |
Skin Sensitization: | 0.968 | Carcinogencity: | 0.533 |
Eye Corrosion: | 0.864 | Eye Irritation: | 0.879 |
Respiratory Toxicity: | 0.973 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002779 | ![]() |
0.727 | D06WTZ | ![]() |
0.244 | ||
ENC002780 | ![]() |
0.648 | D02RQU | ![]() |
0.242 | ||
ENC002482 | ![]() |
0.506 | D03SXE | ![]() |
0.241 | ||
ENC002137 | ![]() |
0.344 | D08TEJ | ![]() |
0.226 | ||
ENC005060 | ![]() |
0.317 | D0Y7LD | ![]() |
0.221 | ||
ENC006099 | ![]() |
0.308 | D0X2LV | ![]() |
0.220 | ||
ENC006098 | ![]() |
0.304 | D0D2TN | ![]() |
0.219 | ||
ENC002887 | ![]() |
0.285 | D00AEQ | ![]() |
0.216 | ||
ENC002888 | ![]() |
0.285 | D04QNO | ![]() |
0.216 | ||
ENC003665 | ![]() |
0.271 | D0Y7IU | ![]() |
0.216 |