|
Name |
Dothideomycetone A
|
Molecular Formula | C25H40O7 | |
IUPAC Name* |
[(1S,6S)-6-hydroxy-3-[2-[(1S,2S,6R)-2-hydroxy-6-methylcyclohexyl]-2-oxoethyl]-4,6-dimethyl-5-oxocyclohex-3-en-1-yl] (2R,3R,4S)-3-hydroxy-2,4-dimethylhexanoate
|
|
SMILES |
CC[C@H](C)[C@H]([C@@H](C)C(=O)O[C@H]1CC(=C(C(=O)[C@@]1(C)O)C)CC(=O)[C@H]2[C@@H](CCC[C@@H]2O)C)O
|
|
InChI |
InChI=1S/C25H40O7/c1-7-13(2)22(28)16(5)24(30)32-20-12-17(15(4)23(29)25(20,6)31)11-19(27)21-14(3)9-8-10-18(21)26/h13-14,16,18,20-22,26,28,31H,7-12H2,1-6H3/t13-,14+,16+,18-,20-,21-,22+,25-/m0/s1
|
|
InChIKey |
YRAPWMYACXYABW-ZEXAJZPYSA-N
|
|
Synonyms |
Dothideomycetone A; CHEMBL3358710; [(1S,6S)-6-hydroxy-3-[2-[(1S,2S,6R)-2-hydroxy-6-methyl-cyclohexyl]-2-oxo-ethyl]-4,6-dimethyl-5-oxo-cyclohex-3-en-1-yl] (2R,3R,4S)-3-hydroxy-2,4-dimethyl-hexanoate
|
|
CAS | NA | |
PubChem CID | 66560297 | |
ChEMBL ID | CHEMBL3358710 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 452.6 | ALogp: | 3.0 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 121.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 32 | QED Weighted: | 0.482 |
Caco-2 Permeability: | -4.655 | MDCK Permeability: | 0.00005540 |
Pgp-inhibitor: | 0.995 | Pgp-substrate: | 0.996 |
Human Intestinal Absorption (HIA): | 0.401 | 20% Bioavailability (F20%): | 0.761 |
30% Bioavailability (F30%): | 0.539 |
Blood-Brain-Barrier Penetration (BBB): | 0.279 | Plasma Protein Binding (PPB): | 72.05% |
Volume Distribution (VD): | 1.08 | Fu: | 18.42% |
CYP1A2-inhibitor: | 0.014 | CYP1A2-substrate: | 0.223 |
CYP2C19-inhibitor: | 0.015 | CYP2C19-substrate: | 0.801 |
CYP2C9-inhibitor: | 0.009 | CYP2C9-substrate: | 0.077 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.032 |
CYP3A4-inhibitor: | 0.765 | CYP3A4-substrate: | 0.445 |
Clearance (CL): | 8.676 | Half-life (T1/2): | 0.177 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.404 |
Drug-inuced Liver Injury (DILI): | 0.92 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.849 | Maximum Recommended Daily Dose: | 0.087 |
Skin Sensitization: | 0.129 | Carcinogencity: | 0.698 |
Eye Corrosion: | 0.027 | Eye Irritation: | 0.023 |
Respiratory Toxicity: | 0.983 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002888 | 1.000 | D08SVH | 0.248 | ||||
ENC002889 | 0.388 | D05RXI | 0.246 | ||||
ENC004897 | 0.371 | D02RQU | 0.241 | ||||
ENC004896 | 0.318 | D0E9KA | 0.239 | ||||
ENC003895 | 0.295 | D0X7XG | 0.236 | ||||
ENC002822 | 0.290 | D06WTZ | 0.233 | ||||
ENC004255 | 0.290 | D03SXE | 0.231 | ||||
ENC004128 | 0.287 | D03KYG | 0.230 | ||||
ENC004127 | 0.287 | D0K7HU | 0.229 | ||||
ENC000943 | 0.285 | D0X6GN | 0.229 |