![]() |
Name |
Asporyzin A
|
Molecular Formula | C28H37NO3 | |
IUPAC Name* |
(1S,2S,5S,7R,9S,10R,13S)-1,2,9-trimethyl-7-(2-methylprop-1-enyl)-6-oxa-22-azapentacyclo[11.10.0.02,10.05,9.016,21]tricosa-16,18,20-triene-15,23-dione
|
|
SMILES |
CC(=C[C@H]1C[C@]2([C@@H]3CC[C@H]4CC(=O)C5=CC=CC=C5NC(=O)[C@@]4([C@]3(CC[C@@H]2O1)C)C)C)C
|
|
InChI |
InChI=1S/C28H37NO3/c1-17(2)14-19-16-26(3)23-11-10-18-15-22(30)20-8-6-7-9-21(20)29-25(31)28(18,5)27(23,4)13-12-24(26)32-19/h6-9,14,18-19,23-24H,10-13,15-16H2,1-5H3,(H,29,31)/t18-,19-,23-,24-,26-,27-,28+/m0/s1
|
|
InChIKey |
WPOJQZPWCWZDGM-VSUSBFIXSA-N
|
|
Synonyms |
ASPORYZIN A; CHEMBL1258864
|
|
CAS | NA | |
PubChem CID | 52947705 | |
ChEMBL ID | CHEMBL1258864 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 435.6 | ALogp: | 5.7 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.4 | Aromatic Rings: | 5 |
Heavy Atoms: | 32 | QED Weighted: | 0.535 |
Caco-2 Permeability: | -4.998 | MDCK Permeability: | 0.00002550 |
Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.009 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.506 |
30% Bioavailability (F30%): | 0.84 |
Blood-Brain-Barrier Penetration (BBB): | 0.058 | Plasma Protein Binding (PPB): | 93.24% |
Volume Distribution (VD): | 0.871 | Fu: | 3.39% |
CYP1A2-inhibitor: | 0.103 | CYP1A2-substrate: | 0.67 |
CYP2C19-inhibitor: | 0.711 | CYP2C19-substrate: | 0.851 |
CYP2C9-inhibitor: | 0.55 | CYP2C9-substrate: | 0.056 |
CYP2D6-inhibitor: | 0.352 | CYP2D6-substrate: | 0.11 |
CYP3A4-inhibitor: | 0.931 | CYP3A4-substrate: | 0.784 |
Clearance (CL): | 17.42 | Half-life (T1/2): | 0.051 |
hERG Blockers: | 0.384 | Human Hepatotoxicity (H-HT): | 0.84 |
Drug-inuced Liver Injury (DILI): | 0.855 | AMES Toxicity: | 0.538 |
Rat Oral Acute Toxicity: | 0.856 | Maximum Recommended Daily Dose: | 0.883 |
Skin Sensitization: | 0.77 | Carcinogencity: | 0.398 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
Respiratory Toxicity: | 0.957 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005883 | ![]() |
0.689 | D0Q6NZ | ![]() |
0.303 | ||
ENC000857 | ![]() |
0.479 | D0U3GL | ![]() |
0.282 | ||
ENC005882 | ![]() |
0.452 | D04GJN | ![]() |
0.266 | ||
ENC001931 | ![]() |
0.442 | D08QKJ | ![]() |
0.266 | ||
ENC004710 | ![]() |
0.435 | D0F1UL | ![]() |
0.264 | ||
ENC003932 | ![]() |
0.428 | D0V2JK | ![]() |
0.264 | ||
ENC003874 | ![]() |
0.425 | D0EP0C | ![]() |
0.259 | ||
ENC003933 | ![]() |
0.419 | D0I2SD | ![]() |
0.256 | ||
ENC002707 | ![]() |
0.389 | D0G8BV | ![]() |
0.254 | ||
ENC003928 | ![]() |
0.382 | D0V4WD | ![]() |
0.254 |