![]() |
Name |
Pestalotiollide A
|
Molecular Formula | C21H22O7 | |
IUPAC Name* |
2-[(1R,2S)-1,2-dihydroxy-3-methylbut-3-enyl]-6-hydroxy-1-methoxy-8-methyl-10H-benzo[b][1,5]benzodioxocin-12-one
|
|
SMILES |
CC1=CC2=C(C(=C1)O)OC3=C(C(=C(C=C3)[C@H]([C@H](C(=C)C)O)O)OC)C(=O)OC2
|
|
InChI |
InChI=1S/C21H22O7/c1-10(2)17(23)18(24)13-5-6-15-16(20(13)26-4)21(25)27-9-12-7-11(3)8-14(22)19(12)28-15/h5-8,17-18,22-24H,1,9H2,2-4H3/t17-,18+/m0/s1
|
|
InChIKey |
HHLSDNCZICXJDV-ZWKOTPCHSA-N
|
|
Synonyms |
Pestalotiollide A
|
|
CAS | NA | |
PubChem CID | 52920649 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 386.4 | ALogp: | 2.6 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 105.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 28 | QED Weighted: | 0.54 |
Caco-2 Permeability: | -5.048 | MDCK Permeability: | 0.00001310 |
Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.111 |
Human Intestinal Absorption (HIA): | 0.037 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.108 | Plasma Protein Binding (PPB): | 92.73% |
Volume Distribution (VD): | 1.119 | Fu: | 6.82% |
CYP1A2-inhibitor: | 0.71 | CYP1A2-substrate: | 0.784 |
CYP2C19-inhibitor: | 0.272 | CYP2C19-substrate: | 0.407 |
CYP2C9-inhibitor: | 0.324 | CYP2C9-substrate: | 0.55 |
CYP2D6-inhibitor: | 0.468 | CYP2D6-substrate: | 0.248 |
CYP3A4-inhibitor: | 0.203 | CYP3A4-substrate: | 0.289 |
Clearance (CL): | 10.101 | Half-life (T1/2): | 0.58 |
hERG Blockers: | 0.044 | Human Hepatotoxicity (H-HT): | 0.014 |
Drug-inuced Liver Injury (DILI): | 0.324 | AMES Toxicity: | 0.369 |
Rat Oral Acute Toxicity: | 0.886 | Maximum Recommended Daily Dose: | 0.934 |
Skin Sensitization: | 0.557 | Carcinogencity: | 0.392 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.385 |
Respiratory Toxicity: | 0.675 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002740 | ![]() |
1.000 | D0F7CS | ![]() |
0.295 | ||
ENC004016 | ![]() |
0.786 | D07MGA | ![]() |
0.292 | ||
ENC004017 | ![]() |
0.744 | D0L1JW | ![]() |
0.289 | ||
ENC001921 | ![]() |
0.724 | D04UTT | ![]() |
0.283 | ||
ENC004018 | ![]() |
0.705 | D06GCK | ![]() |
0.283 | ||
ENC002005 | ![]() |
0.663 | D04TDQ | ![]() |
0.268 | ||
ENC006147 | ![]() |
0.613 | D09DHY | ![]() |
0.258 | ||
ENC001927 | ![]() |
0.577 | D0G4KG | ![]() |
0.252 | ||
ENC004019 | ![]() |
0.576 | D0W8WB | ![]() |
0.252 | ||
ENC006146 | ![]() |
0.537 | D06GIP | ![]() |
0.250 |