![]() |
Name |
Purpactin A
|
Molecular Formula | C23H26O7 | |
IUPAC Name* |
[(1S)-1-(6-hydroxy-1-methoxy-8-methyl-12-oxo-10H-benzo[b][1,5]benzodioxocin-2-yl)-3-methylbutyl] acetate
|
|
SMILES |
CC1=CC2=C(C(=C1)O)OC3=C(C(=C(C=C3)[C@H](CC(C)C)OC(=O)C)OC)C(=O)OC2
|
|
InChI |
InChI=1S/C23H26O7/c1-12(2)8-19(29-14(4)24)16-6-7-18-20(22(16)27-5)23(26)28-11-15-9-13(3)10-17(25)21(15)30-18/h6-7,9-10,12,19,25H,8,11H2,1-5H3/t19-/m0/s1
|
|
InChIKey |
NUYFKDBCHFKOBT-IBGZPJMESA-N
|
|
Synonyms |
Purpactin A; AS-186b; 1'-O-acetylpenicillide; CHEMBL116226; CHEBI:65444; (1S)-1-(11-hydroxy-4-methoxy-9-methyl-5-oxo-5H,7H-dibenzo[b,g][1,5]dioxocin-3-yl)-3-methylbutyl acetate; FO-608A; ZINC6070257; BDBM50281511; Q27133890; [(1S)-1-(6-hydroxy-1-methoxy-8-methyl-12-oxo-10H-benzo[b][1,5]benzodioxocin-2-yl)-3-methylbutyl] acetate; Acetic acid (S)-1-(11-hydroxy-4-methoxy-9-methyl-5-oxo-5H,7H-6,12-dioxa-dibenzo[a,d]cycloocten-3-yl)-3-methyl-butyl ester
|
|
CAS | 133806-59-4 | |
PubChem CID | 10341722 | |
ChEMBL ID | CHEMBL116226 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 414.4 | ALogp: | 4.3 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 91.3 | Aromatic Rings: | 3 |
Heavy Atoms: | 30 | QED Weighted: | 0.671 |
Caco-2 Permeability: | -4.869 | MDCK Permeability: | 0.00002130 |
Pgp-inhibitor: | 0.412 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.021 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.01 |
Blood-Brain-Barrier Penetration (BBB): | 0.159 | Plasma Protein Binding (PPB): | 97.86% |
Volume Distribution (VD): | 0.693 | Fu: | 6.47% |
CYP1A2-inhibitor: | 0.559 | CYP1A2-substrate: | 0.553 |
CYP2C19-inhibitor: | 0.934 | CYP2C19-substrate: | 0.46 |
CYP2C9-inhibitor: | 0.871 | CYP2C9-substrate: | 0.915 |
CYP2D6-inhibitor: | 0.413 | CYP2D6-substrate: | 0.486 |
CYP3A4-inhibitor: | 0.482 | CYP3A4-substrate: | 0.569 |
Clearance (CL): | 7.642 | Half-life (T1/2): | 0.429 |
hERG Blockers: | 0.027 | Human Hepatotoxicity (H-HT): | 0.07 |
Drug-inuced Liver Injury (DILI): | 0.659 | AMES Toxicity: | 0.517 |
Rat Oral Acute Toxicity: | 0.836 | Maximum Recommended Daily Dose: | 0.937 |
Skin Sensitization: | 0.345 | Carcinogencity: | 0.873 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.763 |
Respiratory Toxicity: | 0.666 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003674 | ![]() |
0.822 | D09DHY | ![]() |
0.296 | ||
ENC001921 | ![]() |
0.773 | D0L1JW | ![]() |
0.286 | ||
ENC000877 | ![]() |
0.773 | D04TDQ | ![]() |
0.275 | ||
ENC004018 | ![]() |
0.714 | D0F7CS | ![]() |
0.271 | ||
ENC004016 | ![]() |
0.677 | D06GCK | ![]() |
0.269 | ||
ENC006148 | ![]() |
0.663 | D02LZB | ![]() |
0.266 | ||
ENC002739 | ![]() |
0.663 | D0O6KE | ![]() |
0.264 | ||
ENC002740 | ![]() |
0.663 | D06GIP | ![]() |
0.261 | ||
ENC004017 | ![]() |
0.625 | D04FBR | ![]() |
0.261 | ||
ENC001927 | ![]() |
0.590 | D04UTT | ![]() |
0.260 |